| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
OTAVA chemicals |
| Tel: |
416 305 9979 (Canada) |
| Email: |
north.america@otavachemicals.com |
|
| | 1-(2,4-dihydroxyphenyl)-2-(3-methylphenoxy)ethan-1-one Basic information |
| | 1-(2,4-dihydroxyphenyl)-2-(3-methylphenoxy)ethan-1-one Chemical Properties |
| Melting point | 162°C | | Boiling point | 486.5±24.0 °C(Predicted) | | density | 1.275±0.06 g/cm3(Predicted) | | form | solid | | pka | 7.32±0.35(Predicted) | | InChI | 1S/C15H14O4/c1-10-3-2-4-12(7-10)19-9-15(18)13-6-5-11(16)8-14(13)17/h2-8,16-17H,9H2,1H3 | | InChIKey | SWINKNFGLSMXBH-UHFFFAOYSA-N | | SMILES | O(CC(=O)c2c(cc(cc2)O)O)c1cc(ccc1)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-(2,4-dihydroxyphenyl)-2-(3-methylphenoxy)ethan-1-one Usage And Synthesis |
| Preparation | Obtained by reaction of 3-methylphenoxyacetonitrile with resorcinol (Hoesch reaction) (82%). |
| | 1-(2,4-dihydroxyphenyl)-2-(3-methylphenoxy)ethan-1-one Preparation Products And Raw materials |
|