|
|
| | 6,8-dichlorooctanoic acid Basic information |
| Product Name: | 6,8-dichlorooctanoic acid | | Synonyms: | 6,8-DICHLOROETHYLCAPRYLATE;6,8-DICHLOROCAPRYLATE;Octanoic acid,6,8-dichloro-;Thioctic Acid Impurity 25;6,8-dichlorooctanoic acid;6,8-dichlorooctanoic acid ISO 9001:2015 REACH;Lipoic Acid Impurity 13;6,8-Dichloroethyl caprylate CAS NO.41443-60-1 | | CAS: | 41443-60-1 | | MF: | C8H14Cl2O2 | | MW: | 213.1 | | EINECS: | 1308068-626-2 | | Product Categories: | Organic acids;Ester series | | Mol File: | 41443-60-1.mol |  |
| | 6,8-dichlorooctanoic acid Chemical Properties |
| Boiling point | 323.0±32.0 °C(Predicted) | | density | 1.107 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.462(lit.) | | Fp | >230 °F | | pka | 4.73±0.10(Predicted) | | InChI | InChI=1S/C8H14Cl2O2/c9-6-5-7(10)3-1-2-4-8(11)12/h7H,1-6H2,(H,11,12) | | InChIKey | HSKAEXWPLIDFGC-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCC(Cl)CCCl | | CAS DataBase Reference | 41443-60-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 |
| | 6,8-dichlorooctanoic acid Usage And Synthesis |
| Chemical Properties | Colorless to pale yellow liquid | | Uses | 6,8-Dichloro-octanoic Acid is an Intermediate in the synthesis of α-Lipoic acid (L468750) and its derivatives. | | Uses | 6,8-Dichloro-octanoate is a Intermediate in the synthesis of α-Lipoic acid (L468750) and its derivatives. |
| | 6,8-dichlorooctanoic acid Preparation Products And Raw materials |
|