- H-Lys(Boc)-OMe HCl
-
- $1790.00 / 1Kg
-
2024-03-27
- CAS:2389-48-2
- Min. Order: 1Kg
- Purity: 98
- Supply Ability: 500 Kg
|
| | N-Boc-L-lysine methyl ester hydrochloride Basic information |
| | N-Boc-L-lysine methyl ester hydrochloride Chemical Properties |
| Melting point | 158-159 °C(Solv: methanol (67-56-1); ethyl ether (60-29-7)) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in methanol. | | form | Solid | | color | White to off-white | | Optical Rotation | 13.71°(C=0.010069 g/ml H2O) | | BRN | 5173577 | | Stability: | Hygroscopic | | Major Application | peptide synthesis | | InChI | InChI=1/C12H24N2O4.ClH/c1-12(2,3)18-11(16)14-8-6-5-7-9(13)10(15)17-4;/h9H,5-8,13H2,1-4H3,(H,14,16);1H/t9-;/s3 | | InChIKey | NANRHOPPXCBHGI-OVMXBOEKNA-N | | SMILES | C(=O)(OC(C)(C)C)NCCCC[C@H](N)C(=O)OC.Cl |&1:12,r| | | CAS DataBase Reference | 2389-48-2(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2924190090 | | Storage Class | 11 - Combustible Solids |
| | N-Boc-L-lysine methyl ester hydrochloride Usage And Synthesis |
| Chemical Properties | White powder | | Uses | H-Lys(Boc)OMe HCl | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Boc-L-lysine methyl ester hydrochloride Preparation Products And Raw materials |
|