| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | cis-2-Amino-cycloheptanecarboxylic acid hydrochloride Basic information |
| | cis-2-Amino-cycloheptanecarboxylic acid hydrochloride Chemical Properties |
| form | powder or crystals | | color | colorless to white | | Major Application | peptide synthesis | | InChI | 1S/C8H15NO2.ClH/c9-7-5-3-1-2-4-6(7)8(10)11;/h6-7H,1-5,9H2,(H,10,11);1H/t6-,7+;/m0./s1 | | InChIKey | KCRZBDJVYOBHIP-UOERWJHTSA-N | | SMILES | Cl.N[C@@H]1CCCCC[C@@H]1C(O)=O |
| WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids |
| | cis-2-Amino-cycloheptanecarboxylic acid hydrochloride Usage And Synthesis |
| | cis-2-Amino-cycloheptanecarboxylic acid hydrochloride Preparation Products And Raw materials |
|