|
|
| | 1,2-Bis(tetrabromophthalimido) ethane Basic information |
| Product Name: | 1,2-Bis(tetrabromophthalimido) ethane | | Synonyms: | Ethylene double tetrabromophthalimide (RDT-5);Ethylene double tetrabromophthalimide;FR-RDT 5;4,5,6,7-tetrabromo-2-[2-(4,5,6,7-tetrabromo-1,3-dioxo-2-isoindolyl)ethyl]isoindole-1,3-dione;BT-93W;ETHYLENE BIS-(TETRABROMOPHTHALIMIDE);1,2-bis(tetrabromophthalimido) ethane;2,2'-ETHYLENEBIS-(4,5,6,7-TETRABROMOPHTHALIMIDE) | | CAS: | 32588-76-4 | | MF: | C18H4Br8N2O4 | | MW: | 951.47 | | EINECS: | 251-118-6 | | Product Categories: | Organics | | Mol File: | 32588-76-4.mol |  |
| | 1,2-Bis(tetrabromophthalimido) ethane Chemical Properties |
| Melting point | 446°C | | Boiling point | 827.9±65.0 °C(Predicted) | | density | 2.67 | | vapor pressure | 0Pa at 20℃ | | storage temp. | Room Temperature | | pka | -4.12±0.20(Predicted) | | form | Solid | | color | White to Off-White | | Water Solubility | <0.1 g/100 mL at 21 ºC | | Henry's Law Constant | 2.7×1015 mol/(m3Pa) at 25℃, HSDB (2015) | | InChI | InChI=1S/C18H4Br8N2O4/c19-7-3-4(8(20)12(24)11(7)23)16(30)27(15(3)29)1-2-28-17(31)5-6(18(28)32)10(22)14(26)13(25)9(5)21/h1-2H2 | | InChIKey | DYIZJUDNMOIZQO-UHFFFAOYSA-N | | SMILES | C(N1C(=O)C2=C(C1=O)C(Br)=C(Br)C(Br)=C2Br)CN1C(=O)C2=C(C1=O)C(Br)=C(Br)C(Br)=C2Br | | LogP | 9.797 | | CAS DataBase Reference | 32588-76-4(CAS DataBase Reference) | | EPA Substance Registry System | N,N'-Ethylenebis[tetrabromophthalimide] (32588-76-4) |
| | 1,2-Bis(tetrabromophthalimido) ethane Usage And Synthesis |
| Uses | Ethylenebis(tetrabromophthalimide) is an additive fire retardant that is added to a polymer mixture to produce a blend. Ethylenebis(tetrabromophthalimide) is used in high impact polystyrene (HIPS), polyethylene, polypropylene, thermoplastic polyesters, polyamide, ethylene propylene-diene terpolymers (EPDM rubbers) and other synthetic rubbers, polycarbonate, ethylene copolymers, ionomer resins, epoxies, and textile treatments. | | General Description | Yellow powder. | | Air & Water Reactions | Insoluble in water. | | Reactivity Profile | 1,2-Bis(tetrabromophthalimido) ethane may react with strong oxidizers. | | Hazard | Low toxicity by ingestion, inhalation, and
skin contact. A mild eye irritant. | | Fire Hazard | Flash point data for 1,2-Bis(tetrabromophthalimido) ethane are not available but 1,2-Bis(tetrabromophthalimido) ethane is probably non-flammable. |
| | 1,2-Bis(tetrabromophthalimido) ethane Preparation Products And Raw materials |
|