|
|
| | DI-N-BUTYLTIN BIS(2-ETHYLHEXANOATE) Basic information |
| Product Name: | DI-N-BUTYLTIN BIS(2-ETHYLHEXANOATE) | | Synonyms: | Dibutyltin bis(2-ethylhexanoate),98%;bis(2-ethylhexanoyloxy)dibutyl-stannan;dibutylbis((2-ethyl-1-oxohexyl)oxy)-stannan;dibutylbis((2-ethyl-1-oxohexyl)oxy)stannane;dibutylbis((2-ethylhexanoyl)oxy)-stannan;dibutylbis[(2-ethyl-1-oxohexyl)oxy]-stannan;dibutylbis[(2-ethyl-1-oxohexyl)oxy]-Stannane;dibutyltinbis(alpha-ethylhexanoate) | | CAS: | 2781-10-4 | | MF: | C24H48O4Sn | | MW: | 519.35 | | EINECS: | 220-481-2 | | Product Categories: | | | Mol File: | 2781-10-4.mol |  |
| | DI-N-BUTYLTIN BIS(2-ETHYLHEXANOATE) Chemical Properties |
| Melting point | 57-59 °C(lit.) | | Boiling point | 215-20°C 2mm | | density | 1,07 g/cm3 | | vapor pressure | 0.1Pa at 19.85℃ | | refractive index | 1.4653 | | Fp | 26°C | | solubility | Soluble in mineral oil, acetone, xylene | | form | solid | | Specific Gravity | 1.07 | | Water Solubility | 4mg/L at 20℃ | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 | | InChI | InChI=1S/2C8H16O2.2C4H9.Sn/c2*1-3-5-6-7(4-2)8(9)10;2*1-3-4-2;/h2*7H,3-6H2,1-2H3,(H,9,10);2*1,3-4H2,2H3;/q;;;;+2/p-2 | | InChIKey | GPDWNEFHGANACG-UHFFFAOYSA-L | | SMILES | [Sn](OC(=O)C(CC)CCCC)(OC(=O)C(CC)CCCC)(CCCC)CCCC | | CAS DataBase Reference | 2781-10-4(CAS DataBase Reference) | | EPA Substance Registry System | Hexanoic acid, 2-ethyl-, 1,1'-(dibutylstannylene) ester (2781-10-4) |
| Hazard Codes | T,N,C | | Risk Statements | 23/24/25-36/37/38-50/53-43-34 | | Safety Statements | 26-28-36/37/39-45-61-60 | | RIDADR | UN 3146 6.1/PG 3 | | WGK Germany | 3 | | RTECS | WH6714500 | | TSCA | Yes | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29310099 | | Toxicity | mouse,LD50,intravenous,178mg/kg (178mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#00178, |
| | DI-N-BUTYLTIN BIS(2-ETHYLHEXANOATE) Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | Di-n-butyltin bis(2-ethylhexanoate) is used in silanol condensation reactions for caulk and sealant applications and in the production of silicones. It is also used in one or two component systems which are compatible with aromatic solvents. |
| | DI-N-BUTYLTIN BIS(2-ETHYLHEXANOATE) Preparation Products And Raw materials |
|