- L-Leu-OBzl.TosOH
-
-
2026-07-03
- CAS:1738-77-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | L-Leucine benzyl ester p-toluenesulfonate salt Basic information |
| | L-Leucine benzyl ester p-toluenesulfonate salt Chemical Properties |
| Melting point | 153-160 °C | | refractive index | 5 ° (C=2, DMF) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D +5.0±0.3°, c = 2% in DMF | | BRN | 3566840 | | InChI | InChI=1/C13H19NO2.C7H8O3S/c1-10(2)8-12(14)13(15)16-9-11-6-4-3-5-7-11;1-6-2-4-7(5-3-6)11(8,9)10/h3-7,10,12H,8-9,14H2,1-2H3;2-5H,1H3,(H,8,9,10)/t12-;/s3 | | InChIKey | QTQGHKVYLQBJLO-ZLBVLXFENA-N | | SMILES | C1(S(=O)(=O)O)C=CC(C)=CC=1.C1(=CC=CC=C1)COC(=O)[C@@H](N)CC(C)C |&1:21,r| | | CAS DataBase Reference | 1738-77-8(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29242990 |
| | L-Leucine benzyl ester p-toluenesulfonate salt Usage And Synthesis |
| Chemical Properties | White powder | | Uses | L-Leucine Benzyl Ester p-Toluenesulfonate has been used as a reactant in the synthesis of MA026, a lipocyclodepsipeptide with anti-hepatitis C virus activity. |
| | L-Leucine benzyl ester p-toluenesulfonate salt Preparation Products And Raw materials |
|