| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:FenaMiphos sulfoxide CAS:31972-43-7 Purity:100 μg/ML in Methanol Package:1ML
|
| Company Name: |
Sichuan Kulinan Technology Co., Ltd
|
| Tel: |
400-1166-196 18981987031 |
| Email: |
cdhxsj@163.com |
| Products Intro: |
Product Name:FENAMIPHOS SULFOXIDE CAS:31972-43-7 Purity:99% HPLC Package:10g;50g;100g;500g;1kg;5kg;25kg
|
|
| | FENAMIPHOS SULFOXIDE Basic information |
| | FENAMIPHOS SULFOXIDE Chemical Properties |
| Boiling point | 436.5±55.0 °C(Predicted) | | density | 1.22±0.1 g/cm3(Predicted) | | Fp | >65 °C | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | -0.34±0.70(Predicted) | | BRN | 2390888 | | Stability: | Hygroscopic | | Major Application | agriculture environmental | | InChI | 1S/C13H22NO4PS/c1-6-17-19(15,14-10(2)3)18-12-7-8-13(20(5)16)11(4)9-12/h7-10H,6H2,1-5H3,(H,14,15) | | InChIKey | LUQMWGMGWJEGAT-UHFFFAOYSA-N | | SMILES | CCOP(=O)(NC(C)C)Oc1ccc(c(C)c1)S(C)=O | | EPA Substance Registry System | Phosphoramidic acid, N-(1-methylethyl)-, ethyl 3-methyl-4-(methylsulfinyl)phenyl ester (31972-43-7) |
| Hazard Codes | T+,N | | Risk Statements | 28-50/53 | | Safety Statements | 28-36/37-45-60-61 | | RIDADR | 2783 | | WGK Germany | 3 | | HazardClass | 6.1(a) | | PackingGroup | I | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral |
| | FENAMIPHOS SULFOXIDE Usage And Synthesis |
| Chemical Properties | Colourless Oil | | Uses | A toxic metabolite of Fenamiphos, a pesticide in fruits and vegetables. |
| | FENAMIPHOS SULFOXIDE Preparation Products And Raw materials |
|