|
|
| | 4-Chloro-5-sulphamoylbenzoic acid Basic information |
| | 4-Chloro-5-sulphamoylbenzoic acid Chemical Properties |
| Melting point | 256-258 °C (lit.) | | Boiling point | 502.4±60.0 °C(Predicted) | | density | 1.649±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.44±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C7H6ClNO4S/c8-5-2-1-4(7(10)11)3-6(5)14(9,12)13/h1-3H,(H,10,11)(H2,9,12,13) | | InChIKey | FHQAWINGVCDTTG-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(Cl)C(S(N)(=O)=O)=C1 | | CAS DataBase Reference | 1205-30-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | DG5642600 | | HS Code | 29350090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | | Toxicity | mouse,LD50,intravenous,> 2gm/kg (2000mg/kg),BEHAVIORAL: ATAXIABEHAVIORAL: TREMORLUNGS, THORAX, OR RESPIRATION: RESPIRATORY DEPRESSION,Kiso to Rinsho. Clinical Report. Vol. 16, Pg. 2275, 1982. |
| | 4-Chloro-5-sulphamoylbenzoic acid Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | 4-Chloro-3-sulfamoylbenzoic Acid (cas# 1205-30-7) is a compound useful in organic synthesis. | | Definition | ChEBI: 4-chloro-3-sulfamoylbenzoic acid is a sulfonamide. | | General Description | 4-Chloro-3-sulfamoylbenzoic acid is the major metabolite of tripamide (N-(4-aza-endo-tricyclo[5.2.1.0(2,6))]-decan-4-yl)-4-chloro-3-sulfamoylbenzamide), new antihypertensive agent. It is present as impurity in clopamide tablets and has been quantitated by chromatographic-densitometric method. |
| | 4-Chloro-5-sulphamoylbenzoic acid Preparation Products And Raw materials |
|