- Trioctylphosphine
-
- $1.00 / 1KG
-
2025-12-12
- CAS:4731-53-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 tons
- TRI-N-OCTYLPHOSPHINE
-
- $0.00 / 1kg
-
2025-06-20
- CAS:4731-53-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100tons
- Trioctylphosphine
-
- $1.70 / 1kg
-
2025-05-26
- CAS:4731-53-7
- Min. Order: 10kg
- Purity: 92%
- Supply Ability: 10000kg
|
| | Trioctylphosphine Basic information |
| | Trioctylphosphine Chemical Properties |
| Melting point | 30°C | | Boiling point | 284-291 °C50 mm Hg(lit.) | | density | 0.831 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.468(lit.) | | Fp | 297 °F | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | Powder or Crystalline Powder | | color | White to off-white | | Specific Gravity | 0.831 | | Water Solubility | Immiscible with water. | | Sensitive | Air Sensitive | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | BRN | 1776995 | | InChI | InChI=1S/C24H51P/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3 | | InChIKey | RMZAYIKUYWXQPB-UHFFFAOYSA-N | | SMILES | P(CCCCCCCC)(CCCCCCCC)CCCCCCCC | | CAS DataBase Reference | 4731-53-7(CAS DataBase Reference) | | EPA Substance Registry System | Phosphine, trioctyl- (4731-53-7) |
| Hazard Codes | C,Xi | | Risk Statements | 34-36/37/38 | | Safety Statements | 26-36/37/39-45-37/39 | | RIDADR | UN 1760 8/PG 2 | | WGK Germany | 2 | | RTECS | SZ3450000 | | F | 10-13-23 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29310099 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | Trioctylphosphine Usage And Synthesis |
| Description | Trioctylphosphine (also known as Tri-n-octylphosphine, abbreviated as TOP) is a weakly basic organophosphorus compound that can be used in the synthesis of nanomaterials (such as metallic nanoparticles). It also serves as the most popular organophosphorus source in oil-phase synthesis, a stabiliser for certain nanorods, and acts as a solvent in certain chemical processes. | | Chemical Properties | Trioctylphosphine abbreviated as TOP, is a colorless liquid with garlic odor, easily oxidized to tri-n-octylphosphine oxide in air. | | Uses | Tri-n-octylphosphine is used for coating zinc sulfide shells on cadmium-selenium quantum dot core by successive ionic layer adsorption and reaction method. It acts as a precursor to trioctylphosphine oxide. Further, it is used as a solvent for cadmium and selenium precursors. It also serves as a common reagent in the chemical synthesis of nanoparticles. It acts as a precursor to trioctylphosphine oxide. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | Trioctylphosphine Preparation Products And Raw materials |
|