1,5-HEXADIENE DIEPOXIDE manufacturers
- 1,2:5,6-Diepoxyhexane
-
- $1.00 / 1KG
-
2020-01-10
- CAS:1888-89-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 200KG
|
| | 1,5-HEXADIENE DIEPOXIDE Basic information |
| Product Name: | 1,5-HEXADIENE DIEPOXIDE | | Synonyms: | 1,2:5,6-diepoxy-hexan;1,2,5,6-DIEPOXYHEXANE;1,2:5,6-DIEPOXYHEXANE;Hexadienediepoxide;1,2,5,6-Diepoxyhexane, GC 97%;1,5-HEXADIENE DIEPOXIDE 95+%;1,2:5,6-DIANHYDRO-3,4-DIDEOXY-HEXITOL;1,2-Bisoxiranylethane | | CAS: | 1888-89-7 | | MF: | C6H10O2 | | MW: | 114.14 | | EINECS: | 217-564-0 | | Product Categories: | Oxiranes;Simple 3-Membered Ring Compounds | | Mol File: | 1888-89-7.mol |  |
| | 1,5-HEXADIENE DIEPOXIDE Chemical Properties |
| Boiling point | 62 °C (300 mmHg) | | density | 0.98 | | refractive index | 1.439-1.441 | | Fp | 97 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 0.98 | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C6H10O2/c1(5-3-7-5)2-6-4-8-6/h5-6H,1-4H2 | | InChIKey | HTJFSXYVAKSPNF-UHFFFAOYSA-N | | SMILES | C1(OC1)CCC1OC1 |
| Provider | Language |
|
ACROS
| English |
| | 1,5-HEXADIENE DIEPOXIDE Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 1,2,5,6-Diepoxyhexane is an intermediate used to prepare C13-22 fragment of amphidinolide T2 via nickel-catalyzed reductive coupling of alkyne and terminal epoxide. |
| | 1,5-HEXADIENE DIEPOXIDE Preparation Products And Raw materials |
|