|
|
| | Bis(trimethylsilyl)carbodiimide Basic information |
| Product Name: | Bis(trimethylsilyl)carbodiimide | | Synonyms: | Bis(trimethylsilyl)carbodiimide,98%;Bis(trimethylsily)carbodiimide;N,N'-Methanetetraylbis[1,1,1-triMethyl]-;bis(trimethylsilyl)-carbodiimid;n,n’-methanetetraylbis(1,1,1-trimethyl-silanamin;n,n’-methanetetraylbis(1,1,1-trimethylsilanamine);n,n’-methanetetraylbis[1,1,1-trimethyl-silanamin;1,3-BIS(TRIMETHYLSILYL)CARBODIIMIDE | | CAS: | 1000-70-0 | | MF: | C7H18N2Si2 | | MW: | 186.4 | | EINECS: | 213-673-2 | | Product Categories: | Others;Synthetic Reagents;C-X Bond Formation (Non-Halogen);Si (Classes of Silicon Compounds);Si-N Compounds;Trimethylsilylazide, etc.;Industrial/Fine Chemicals | | Mol File: | 1000-70-0.mol |  |
| | Bis(trimethylsilyl)carbodiimide Chemical Properties |
| Melting point | −23 °C(lit.) | | Boiling point | 164 °C(lit.) | | density | 0.821 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.434(lit.) | | Fp | 109 °F | | storage temp. | Flammables area | | form | Crystalline Powder, Crystals and/or Chunks | | color | White or pale yellow to beige | | Specific Gravity | 0.821 | | Sensitive | Moisture Sensitive | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | BRN | 2042082 | | InChI | InChI=1S/C7H18N2Si2/c1-10(2,3)8-7-9-11(4,5)6/h1-6H3 | | InChIKey | KSVMTHKYDGMXFJ-UHFFFAOYSA-N | | SMILES | N(=C=N[Si](C)(C)C)[Si](C)(C)C | | CAS DataBase Reference | 1000-70-0(CAS DataBase Reference) | | EPA Substance Registry System | Silanamine, N,N'-methanetetraylbis[1,1,1-trimethyl- (1000-70-0) |
| Hazard Codes | F,Xn | | Risk Statements | 11-22-36/37/38-10 | | Safety Statements | 26-36-37/39-16 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 3 | | RTECS | VV1302500 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 | | Toxicity | rabbit,LD50,oral,1728mg/kg (1728mg/kg),BEHAVIORAL: ATAXIABEHAVIORAL: EXCITEMENTBLOOD: HEMORRHAGE,Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 55(6), Pg. 86, 1990. |
| | Bis(trimethylsilyl)carbodiimide Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Reactant for preparation of:
- 4-substituted methoxylbenzoyl-aryl-thiazole analogues as potent and orally bioavailable anticancer agents
- O-silylurethanes
- Porous SiCN materials
- Luminescent diketo-pyrrolo-pyrrole analog
- Hard thin films of silicon carbonitride SiCN as potential protection coatings against wear and corrosion of metals
- Ceramic materials
|
| | Bis(trimethylsilyl)carbodiimide Preparation Products And Raw materials |
|