|
|
| | Borane tert-butylamine complex Basic information |
| | Borane tert-butylamine complex Chemical Properties |
| Melting point | 98-100 °C (dec.)(lit.) | | density | 0,87 g/cm3 | | storage temp. | Refrigerator | | solubility | 27g/l | | form | powder | | color | White to off-white | | Water Solubility | Soluble in water (27 g/L at 20°C) and methanol. | | BRN | 4134905 | | InChI | InChI=1S/C4H11N.BH3/c1-4(2,3)5;/h5H2,1-3H3;1H3 | | InChIKey | GKFJEDWZQZKYHV-UHFFFAOYSA-N | | SMILES | N([H])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H].B | | EPA Substance Registry System | Boron, trihydro(2-methyl-2-propanamine)-, (T-4)- (7337-45-3) |
| Hazard Codes | T | | Risk Statements | 21-25-36/37/38 | | Safety Statements | 26-36/37-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | EO3900000 | | F | 9 | | TSCA | TSCA listed | | HazardClass | 4.1 | | PackingGroup | III | | HS Code | 29299090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Oral
Aquatic Chronic 2
Eye Irrit. 2
Skin Irrit. 2 |
| | Borane tert-butylamine complex Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder | | Uses | Borane-tert-butylamine complex is used in stereoselective reduction of a steroidal ketone and for a review of amine boranes as selective reducing and hydroborating agents. It is also used as strong co-reducing agent in the syntheses of copper (I) oxide nanoparticles, diphosphine-protected gold nanocluster and 4-acetoxycinnamyl alcohols. | | Application | Borane tert-butylamine (BTB) complex may be used as strong co-reducing agent in the following syntheses:
copper (I) oxide nanoparticles
diphosphine-protected gold nanocluster
4-acetoxycinnamyl alcohols
Reactant involved in:
Non-destructive analyses and conservation treatments of Indian drawings
Dehydrogenation reactions mediated by ruthenium bidentate phosphine complexes or ruthenium / iridium bis(N-heterocyclic carbene) complexes
The formation of σ-borane complexes
Ethanolysis of amine-borane adducts to form a reducing system for transfer hydrogenation of terminal olefins
Photochemical hydroboration and oxidation of single-walled carbon nanotubes | | General Description | Borane tert-butylamine complex is a mild reducing agent. It participates in the selective reduction of aldehydes and ketones to corresponding alcohol. It takes part as a reducing agent in the synthesis of monodisperse palladium nanoparticles (Pd NPs), monodisperse gold (Au) nanoparticles and carbon-supported Pd electrocatalysts. | | reaction suitability | reagent type: reductant |
| | Borane tert-butylamine complex Preparation Products And Raw materials |
|