|
|
| | GERMANIUM(IV) ISOPROPOXIDE Basic information |
| Product Name: | GERMANIUM(IV) ISOPROPOXIDE | | Synonyms: | GERMANIUM(IV) ISOPROPOXIDE;GERMANIUM TETRA-I-PROPOXIDE;GERMANIUM TETRAISOPROPOXIDE;GERMANIUM ISO-PROPOXIDE;GERMANIUM ISO-PROPYLATE;Isopropylgermanate;tetraisopropylorthogermanate;TETRAISOPROPOXYGERMANE | | CAS: | 21154-48-3 | | MF: | C12H28GeO4 | | MW: | 308.99 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 21154-48-3.mol |  |
| | GERMANIUM(IV) ISOPROPOXIDE Chemical Properties |
| Boiling point | 167 °C (lit.) | | density | 1.033 g/mL at 25 °C (lit.) | | refractive index | 1.414 | | Fp | 140 °F | | form | Liquid | | Specific Gravity | 1.033 | | color | Colorless | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | Sensitive | Moisture Sensitive | | InChI | 1S/C12H28GeO4/c1-9(2)14-13(15-10(3)4,16-11(5)6)17-12(7)8/h9-12H,1-8H3 | | InChIKey | PKLMYPSYVKAPOX-UHFFFAOYSA-N | | SMILES | CC(C)O[Ge](OC(C)C)(OC(C)C)OC(C)C | | CAS DataBase Reference | 21154-48-3(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2920 8/PG 2 | | WGK Germany | 3 | | TSCA | No | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29051990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3
Skin Corr. 1B |
| | GERMANIUM(IV) ISOPROPOXIDE Usage And Synthesis |
| Chemical Properties | Liquid | | Uses | Germanium(IV) isopropoxide is used as precursor to prepare GeO2 organic silanes, which is used to study the application of optical wave guide. It is used in the synthesis of heterotactic polyactide and also involved in the macromolecule mediated synthesis of amorphous Germania. | | reaction suitability | core: germanium
reagent type: catalyst |
| | GERMANIUM(IV) ISOPROPOXIDE Preparation Products And Raw materials |
|