3,4,5-Trifluorobenzenemethanol manufacturers
|
| | 3,4,5-Trifluorobenzenemethanol Basic information |
| Product Name: | 3,4,5-Trifluorobenzenemethanol | | Synonyms: | RARECHEM AL BD 0343;Benzenemethanol, 3,4,5-trifluoro- (9CI);3,4,5-Trifluorobenzyl alcohol 97%;3,4,5-Trifluorobenzoyl alcohol;(3,4,5-trifluorophenyl)Methanol;3,4,5-TRIFLUOROBENZYL ALCOHOL;3,4,5-TRIFLUORO BENZENEMETHANOL;Benzenemethanol, 3,4,5-trifluoro- | | CAS: | 220227-37-2 | | MF: | C7H5F3O | | MW: | 162.11 | | EINECS: | 642-879-9 | | Product Categories: | HALIDE;Benzhydrols, Benzyl & Special Alcohols;Alcohols;C7 to C8;Oxygen Compounds | | Mol File: | 220227-37-2.mol |  |
| | 3,4,5-Trifluorobenzenemethanol Chemical Properties |
| Boiling point | 203-204 °C760 mm Hg(lit.) | | density | 1.385 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4700(lit.) | | Fp | 210 °F | | storage temp. | Storage temp. 2-8°C | | form | fused solid | | color | White/colourless | | Water Solubility | Soluble in water 100 g/L. | | BRN | 8681069 | | InChI | InChI=1S/C7H5F3O/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2,11H,3H2 | | InChIKey | HRSFRSLKOPFWMZ-UHFFFAOYSA-N | | SMILES | C1(CO)=CC(F)=C(F)C(F)=C1 | | CAS DataBase Reference | 220227-37-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29062990 |
| | 3,4,5-Trifluorobenzenemethanol Usage And Synthesis |
| Uses | 3,4,5-Trifluorobenzyl alcohol is used as chemical reagent. |
| | 3,4,5-Trifluorobenzenemethanol Preparation Products And Raw materials |
|