- SCHIZANDRIN B
-
-
2026-08-22
- CAS:61281-37-6
- Min. Order: 20mg
- Purity: ≥98% HPLC
- Supply Ability: 100
- Schisandrin B
-
- $35.00
-
2026-05-06
- CAS:61281-37-6
- Purity: 99.75%
- Supply Ability: 10g
- Schisandrin B
-
-
2023-02-24
- CAS:61281-37-6
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | SCHIZANDRIN B Basic information |
| Product Name: | SCHIZANDRIN B | | Synonyms: | 6,7-dimethyl-, stereoisomer;Benzo [3,4] cycloocta [1,2-f][1,3]benzodioxole;5,6,7,8-Tetrahydro-1,10,11,12-tetramethoxy-6,7-dimethyl-2,3-(methylenedioxy)dibenzo[a,c]cyclooctene;5,6,7,8-Tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3,4]cycloocta[1,2-f][1,3]benzodioxole;5,6,7,8-Tetrahydro-6,7-dimethyl-1,2,3,13-tetramethoxybenzo[3,4]cycloocta[1,2-f][1,3]benzodioxole;Schizandrin B, froM Schisandra chinensls;Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxole, 5,6,7,8-tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-, (6R,7S,13aR)-rel-;Schisandrin B (Sch B) | | CAS: | 61281-37-6 | | MF: | C23H28O6 | | MW: | 400.47 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract;Inhibitors;Miscellaneous Natural Products | | Mol File: | 61281-37-6.mol |  |
| | SCHIZANDRIN B Chemical Properties |
| Boiling point | 545.0±50.0 °C(Predicted) | | density | 1.148±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO : 14.29 mg/mL (35.68 mM; Need ultrasonic)H2O : < 0.1 mg/mL (insoluble) | | form | powder | | color | White | | Major Application | food and beverages | | InChI | 1S/C23H28O6/c1-12-7-14-9-16(24-3)20(25-4)22(26-5)18(14)19-15(8-13(12)2)10-17-21(23(19)27-6)29-11-28-17/h9-10,12-13H,7-8,11H2,1-6H3 | | InChIKey | RTZKSTLPRTWFEV-UHFFFAOYSA-N | | SMILES | O1COc2c1c(c3c(c2)CC(C(Cc4c3c(c(c(c4)OC)OC)OC)C)C)OC | | CAS DataBase Reference | 61281-37-6(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | SCHIZANDRIN B Usage And Synthesis |
| Chemical Properties | White powder | | Uses | A compound shown to up-regulate cellular antioxidant response. | | Uses | Schizandrin B is a dibenzocyclooctadiene deriv. isolated from Schisandra chinensis and used commonly in traditional Chinese medicine for the treatment of hepatitis and myocardial disorders. | | Definition | ChEBI: An organic heterotetracyclic compound that is found in Fructus Schisandrae and Schisandra chinensis. |
| | SCHIZANDRIN B Preparation Products And Raw materials |
|