- Boc-Asn(Xan)-OH
-
- $0.00 / 1Box
-
2026-01-04
- CAS:65420-40-8
- Min. Order: 1Box
- Purity: 99%
- Supply Ability: 200kg
|
| | N-Boc-N'-xanthyl-L-asparagine Basic information |
| | N-Boc-N'-xanthyl-L-asparagine Chemical Properties |
| Melting point | 177.5-181.5 °C(lit.) | | Boiling point | 650.7±55.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.93±0.10(Predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | [α]20/D +3°, c = 1 in acetone | | BRN | 5172403 | | Major Application | peptide synthesis | | InChIKey | YMGDQLXBNMRJMR-HNNXBMFYSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)NC1c2ccccc2Oc3ccccc13)C(O)=O | | CAS DataBase Reference | 65420-40-8(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29329990 | | Storage Class | 13 - Non Combustible Solids |
| | N-Boc-N'-xanthyl-L-asparagine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Boc-Asn(Xan)-OH, is an Asparagine derivative, used in various chemical synthesis and biology studies. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | N-Boc-N'-xanthyl-L-asparagine Preparation Products And Raw materials |
|