- 12-Bromododecanoic acid
-
- $0.00 / 25kg
-
2025-07-26
- CAS:73367-80-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- 12-Bromododecanoic acid 97%
-
- $15.00 / 1KG
-
2021-07-02
- CAS:73367-80-3
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 12-Bromododecanoic acid Basic information |
| | 12-Bromododecanoic acid Chemical Properties |
| Melting point | 52-55 °C (lit.) | | Boiling point | 140-143 °C(Press: 20 Torr) | | density | 1.191±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | chloroform: soluble50mg/mL, clear to slightly hazy, colorless to faintly yellow | | pka | 4.78±0.10(Predicted) | | form | A crystalline solid | | Appearance | White to off-white Solid | | BRN | 1771588 | | InChI | InChI=1S/C12H23BrO2/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h1-11H2,(H,14,15) | | InChIKey | YYKBWYBUCFHYPR-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCCCCCCCBr | | CAS DataBase Reference | 73367-80-3(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2915907098 |
| | 12-Bromododecanoic acid Usage And Synthesis |
| Uses | 12-Bromododecanoic acid ligand was used as a model fatty acid in the elucidation of the x-ray structure of bovine beta-lactoglobulin. | | Definition | ChEBI: 12-bromododecanoic acid is a bromo fatty acid consisting of lauric acid having a single bromo-substituent at the 12-position. It is functionally related to a dodecanoic acid. |
| | 12-Bromododecanoic acid Preparation Products And Raw materials |
|