| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- (R)-(+)-3-Butyn-2-ol
-
- $9.80
-
2020-01-13
- CAS:42969-65-3
- Min. Order: 1g
- Purity: ≥99%
- Supply Ability: 100kg
|
| | (R)-(+)-3-Butyn-2-ol Basic information |
| | (R)-(+)-3-Butyn-2-ol Chemical Properties |
| Melting point | -22.07°C (estimate) | | Boiling point | 108-111 °C (lit.) | | alpha | 46.7 º (neat) | | density | 0.89 g/mL at 25 °C (lit.) | | refractive index | 1.4235-1.4255 | | Fp | 10°C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 13.28±0.20(Predicted) | | form | Liquid | | Specific Gravity | 0.88 | | color | Clear colorless to yellow | | Optical Rotation | [α]22/D +45°, neat | | BRN | 3587272 | | InChI | InChI=1S/C4H6O/c1-3-4(2)5/h1,4-5H,2H3/t4-/m1/s1 | | InChIKey | GKPOMITUDGXOSB-SCSAIBSYSA-N | | SMILES | C[C@@H](O)C#C | | CAS DataBase Reference | 42969-65-3(CAS DataBase Reference) |
| | (R)-(+)-3-Butyn-2-ol Usage And Synthesis |
| Chemical Properties | clear colorless to yellow liquid | | Uses | (R)-(+)-3-Butyn-2-ol may be used as a starting material in the multi-step synthesis of (R)-benzyl 4-hydroxyl-2-pentynoate. |
| | (R)-(+)-3-Butyn-2-ol Preparation Products And Raw materials |
|