- 4-Fluoro-3-nitrotoluene
-
- $0.00 / 25KG
-
2025-12-01
- CAS:446-11-7
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10000KGS
- 4-Fluoro-3-nitrotoluene
-
- $200.00 / 1KG
-
2025-09-25
- CAS:446-11-7
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 4-Fluoro-3-nitrotoluene Basic information |
| | 4-Fluoro-3-nitrotoluene Chemical Properties |
| Melting point | 28 °C | | Boiling point | 241 °C | | density | 1.262 | | refractive index | 1.524 | | Fp | 22 °C | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | color | Red-brown | | Specific Gravity | 1.262 | | InChI | InChI=1S/C7H6FNO2/c1-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 | | InChIKey | OORBDHOQLZRIQR-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(C)C=C1[N+]([O-])=O | | CAS DataBase Reference | 446-11-7(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Fluoro-3-nitrotoluene(446-11-7) |
| | 4-Fluoro-3-nitrotoluene Usage And Synthesis |
| Description | The molecular structure of 4-fluoro-3-nitrotoluene contains four functional groups: benzene ring, fluorine atom, nitro group and methyl group. Among them, the benzene ring is the basic structural unit of aromatic compounds, the fluorine atom has a strong electron-withdrawing property, the nitro group is a strong electron-withdrawing group, and the methyl group is an electron-donating group. 4-fluoro-3-nitrotoluene has a wide range of applications in organic synthesis, mainly as a pharmaceutical and pesticide intermediate. For example, it can be used to synthesize a variety of drugs, such as cardiovascular drugs, anti-inflammatory drugs, antibiotics, etc. In pesticides, 4-fluoro-3-nitrotoluene can prepare herbicides, fungicides, insecticides, etc. In addition, 4-fluoro-3-nitrotoluene can also be used as an intermediate in synthetic dyes, plastics, synthetic fibers, etc. In analytical chemistry, it can be used as a standard solution for titration analysis, calibration of instruments and devices, evaluation methods, working standards, quality assurance/quality control, etc. |
| | 4-Fluoro-3-nitrotoluene Preparation Products And Raw materials |
|