|
|
| | N,N-Dimethyl-L-phenylalanine Basic information |
| Product Name: | N,N-Dimethyl-L-phenylalanine | | Synonyms: | N,N-DiMethyl-L-phenylalanine 99%;(s)-2-Dimethylamino-3-phenyl-propionic acid;Alanine, N,N-dimethyl-3-phenyl-, L-;L-Phenylalanine, N,N-dimethyl-;N,N-Dimethylphenylalanine;N,N-DIME-PHE-OH;N,N-DIMETHYL-L-PHENYLALANINE;N,N-DIMETHYL-L-PHE-OH | | CAS: | 17469-89-5 | | MF: | C11H15NO2 | | MW: | 193.24 | | EINECS: | | | Product Categories: | N-Methyl Amino Acids;Amino Acid Derivatives;Peptide Synthesis | | Mol File: | 17469-89-5.mol |  |
| | N,N-Dimethyl-L-phenylalanine Chemical Properties |
| Melting point | 225-227 °C(lit.) | | Boiling point | 308.1±35.0 °C(Predicted) | | density | 1?+-.0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.24±0.11(Predicted) | | form | Powder | | color | White to off-white | | optical activity | [α]20/D +77°, c = 1.3 in H2O | | BRN | 2966581 | | InChI | InChI=1S/C11H15NO2/c1-12(2)10(11(13)14)8-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H,13,14)/t10-/m0/s1 | | InChIKey | HOGIQTACRLIOHC-JTQLQIEISA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=CC=C1)N(C)C |
| | N,N-Dimethyl-L-phenylalanine Usage And Synthesis |
| Uses | N,N-Dimethyl-L-phenylalanine is commonly used to prepare Cu(II)-L-amino acid complex, which is a chiral mobile phase additive for the resolution of enantiomers. It can also be used in the total synthesis of (?)-paliurine E and almazole D. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N,N-Dimethyl-L-phenylalanine Preparation Products And Raw materials |
|