- Calcium L-aspartate
-
- $0.00 / 25Kg/Drum
-
2026-04-24
- CAS:21059-46-1
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 1000kg
- Calcium L-Aspartate
-
- $1200.00 / 1ton
-
2025-11-04
- CAS:21059-46-1
- Min. Order: 1ton
- Purity: 99%
- Supply Ability: 1000T/M
- Calcium L-aspartate
-
- $0.00 / 1KG
-
2025-06-27
- CAS:21059-46-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| Product Name: | Calcium L-aspartate | | Synonyms: | CALCIUM L-ASPARTATE;Di-L-Aspartate;Calcium L-aspartic acid;DL-Aspartic acid, calcium salt;Aspartic acid, calcium salt, L- (8CI);Aspara-CA;Astos-CA;Elspri-CA | | CAS: | 21059-46-1 | | MF: | C4H9CaNO4 | | MW: | 175.2 | | EINECS: | 244-185-8 | | Product Categories: | Amino acid salt | | Mol File: | 21059-46-1.mol |  |
| | Calcium L-aspartate Chemical Properties |
| Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1/C4H7NO4.Ca.2H/c5-2(4(8)9)1-3(6)7;;;/h2H,1,5H2,(H,6,7)(H,8,9);;;/t2-;;;/s3 | | InChIKey | BORCSEZTUBAHQM-JBBKJBOGNA-N | | SMILES | [C@@H](N)(C(=O)O)CC(=O)O.[Ca] |&1:0,r| | | LogP | -0.669 (est) | | CAS DataBase Reference | 21059-46-1(CAS DataBase Reference) |
| | Calcium L-aspartate Usage And Synthesis |
| Uses | Amino acid chelated calcium has a stable chemical structure, good lipid solubility, and high absorption rate. | | Application | Calcium aspartate can significantly improve the body's efficiency in absorbing calcium, and this calcium supplement has excellent biocompatibility. Studies have shown that calcium aspartate can stably dissolve in intestinal fluid, and the intestinal villi can efficiently capture it. Molecular-level absorption of calcium aspartate is achieved through the epithelial cells of the intestinal villi. Reductases in these cells convert the calcium ions into zero-valent calcium, which is then transported to the sites of calcium absorption via blood circulation. Simultaneously, aspartic acid undergoes transamination, rapidly forming various amino acids needed by the body. Therefore, the calcium supplementation efficiency of calcium aspartate is over 95%. Furthermore, it transforms the side effects of calcium supplementation into beneficial effects. As a new generation of calcium supplement, calcium aspartate is an amino acid chelated calcium with a stable chemical structure, good fat solubility, and high absorption rate. | | Definition | ChEBI: Calcium L-aspartate is an organic molecular entity. |
| | Calcium L-aspartate Preparation Products And Raw materials |
|