- Sodium taurocholate
-
- $0.00 / 1kg
-
2026-03-06
- CAS:145-42-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: Customise
- Sodium taurocholate
-
- $0.00 / 1G/KG
-
2026-03-06
- CAS:145-42-6
- Min. Order: 1G/KG
- Purity: 99%
- Supply Ability: 100MT
|
| | Sodium taurocholate Basic information |
| Product Name: | Sodium taurocholate | | Synonyms: | 2-([3-ALPHA,7-ALPHA,12-ALPHA-TRIHYDROXY-24-OXO-5-BETA-CHOLAN-24-YL]AMINO)ETHANESULFONIC ACID;ethanesulfonicacid,2-[[(3alpha,5beta,7alpha,12alpha)-3,7,12-trihydroxy-24;monosodiumtaurocholicacid;n-choloyl-taurinsodiumsalt;taurocholatesodium;taurocholatesodiumsalt;5BETA-CHOLANIC ACID-3ALPHA,7ALPHA,12ALPHA-TRIOL 24-N-(2-SULFOETHYL) AMIDE SODIUM;5-BETA-CHOLANIC ACID-3-ALPHA, 7-ALPHA, 12-ALPHA-TRIOL N-(2-SULPHOETHYL)-AMIDE SODIUM SALT | | CAS: | 145-42-6 | | MF: | C26H45NO7S.Na | | MW: | 538.69 | | EINECS: | 205-653-7 | | Product Categories: | Bile Acids;Biochemistry;Steroids;145-42-6;VX:15689727968 | | Mol File: | 145-42-6.mol |  |
| | Sodium taurocholate Chemical Properties |
| Melting point | 230 °C | | alpha | 23 º (c=3 H2O) | | density | 1.177 g/cm3(Temp: 22.5 °C) | | refractive index | 23 ° (C=3, H2O) | | Fp | 9℃ | | storage temp. | -20°C | | solubility | H2O: 0.5 M at 20 °C, clear, colorless to faintly yellow | | pka | 1.9 | | form | Solid | | color | Brown to greenish brown | | PH | pH (30g/l, 25℃) : 4.5~7.5 | | Water Solubility | > 250 g/L (20 ºC) | | Decomposition | 125°C | | Merck | 14,9075 | | BRN | 3901620 | | InChIKey | JAJWGJBVLPIOOH-IZYKLYLVSA-M | | SMILES | [Na+].[S](=O)(=O)([O-])CCNC(=O)CC[C@H]([C@@H]1[C@@]2([C@H]([C@H]3[C@@H]([C@@]4([C@H](C[C@H]3O)C[C@@H](CC4)O)C)C[C@@H]2O)CC1)C)C | | LogP | 0.051 (est) | | CAS DataBase Reference | 145-42-6(CAS DataBase Reference) | | EPA Substance Registry System | Ethanesulfonic acid, 2-[[(3.alpha.,5.beta.,7.alpha.,12.alpha.)-3,7,12-trihydroxy-24-oxocholan-24-yl]amino]-, monosodium salt (145-42-6) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-24/25 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 3 | | RTECS | WX0400000 | | F | 3-10 | | TSCA | TSCA listed | | HS Code | 29049090 | | Storage Class | 11 - Combustible Solids |
| | Sodium taurocholate Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | selectively activates retinoid X receptors (RXRs) | | Uses | Sodium taurocholate is a detergent useful for the solubilization of lipids and membrane-bound proteins. | | Definition | ChEBI: Sodium taurocholate is a bile salt. It contains a taurocholate. | | Biological Activity | Non-sulfated bile salt, physiological transport substrate for the bile salt export pump/sister of Pgp (BSEP/spgp), Na(+)/taurocholate cotransporter (NTCP) and MRP3 into the hepatic carnalicular. | | Purification Methods | Purify it by recrystallisation and gel chromatography using Sephadex LH-20. [Beilstein 10 III 1655, 10 IV 2078.] |
| | Sodium taurocholate Preparation Products And Raw materials |
|