- FMOC-(DMB)GLY-OH
-
- $1.00 / 1KG
-
2019-07-06
- CAS:166881-42-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | FMOC-(DMB)GLY-OH Basic information |
| Product Name: | FMOC-(DMB)GLY-OH | | Synonyms: | FMOC-(DMB)GLY-OH;Fmoc-N-(2,4-dimethoxybenzyl)-glycine;N-ALPHA-FMOC-N-ALPHA-(2, 4-DIMETHOXYBENZYL)-GLYCINE;Fmoc-N-(2,4-dimethoxybenzyl)glycine, Fmoc-Dmb-Gly-OH;Fmoc-N-(2,4-dimethoxybenzyl)-Gly-OH;Fmoc-N(DMB)-Gly-OH;N-[(2,4-Dimethoxyphenyl)methyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]glycine;Fmoc-(Dmb)Gly-OH Novabiochem | | CAS: | 166881-42-1 | | MF: | C26H25NO6 | | MW: | 447.48 | | EINECS: | | | Product Categories: | | | Mol File: | 166881-42-1.mol |  |
| | FMOC-(DMB)GLY-OH Chemical Properties |
| Boiling point | 653.2±55.0 °C(Predicted) | | density | 1.280±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | form | Solid | | pka | 3.81±0.10(Predicted) | | color | White to off-white | | Major Application | peptide synthesis | | InChI | 1S/C26H25NO6/c1-31-18-12-11-17(24(13-18)32-2)14-27(15-25(28)29)26(30)33-16-23-21-9-5-3-7-19(21)20-8-4-6-10-22(20)23/h3-13,23H,14-16H2,1-2H3,(H,28,29) | | InChIKey | UIDQSTVPYKMCEY-UHFFFAOYSA-N | | SMILES | N(Cc4c(cc(cc4)OC)OC)(CC(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | FMOC-(DMB)GLY-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-(DMB)GLY-OH Preparation Products And Raw materials |
|