DITALIMFOS manufacturers
- Ditalimfos
-
- $1520.00
-
2026-05-11
- CAS:5131-24-8
- Purity:
- Supply Ability: 10g
|
| | DITALIMFOS Basic information |
| | DITALIMFOS Chemical Properties |
| Melting point | 85-86℃ | | Boiling point | 400.3±28.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | Fp | >100 °C | | storage temp. | APPROX 4°C | | form | solid | | pka | -3.08±0.20(Predicted) | | Water Solubility | 133mg/L(room temperature) | | BRN | 1542822 | | Henry's Law Constant | 2.3×103 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | Major Application | agriculture | | InChI | 1S/C12H14NO4PS/c1-3-16-18(19,17-4-2)13-11(14)9-7-5-6-8-10(9)12(13)15/h5-8H,3-4H2,1-2H3 | | InChIKey | MTBZIGHNGSTDJV-UHFFFAOYSA-N | | SMILES | CCOP(=S)(OCC)N1C(=O)c2ccccc2C1=O | | EPA Substance Registry System | Ditalimfos (5131-24-8) |
| Hazard Codes | Xi,Xn,F | | Risk Statements | 38-43-36-20/21/22-11 | | Safety Statements | 36/37-16 | | RIDADR | UN2811 6.1/PG 3 | | WGK Germany | 2 | | RTECS | TB2050000 | | HS Code | 29337900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 | | Toxicity | LD50 oral in rabbit: 1gm/kg |
| | DITALIMFOS Usage And Synthesis |
| Uses | Ditalimfos is an organophosphorus pesticide. | | Definition | ChEBI: Ditalimfos is a member of isoindoles and a phthalimide fungicide. |
| | DITALIMFOS Preparation Products And Raw materials |
|