|
|
| | 3-ETHOXY-1,2-PROPANEDIOL Basic information |
| | 3-ETHOXY-1,2-PROPANEDIOL Chemical Properties |
| Boiling point | 222 °C (lit.) | | density | 1.063 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.441(lit.) | | Fp | 110°C | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 13.69±0.20(Predicted) | | color | Colourless | | Stability: | Hygroscopic | | InChI | InChI=1S/C5H12O3/c1-2-8-4-5(7)3-6/h5-7H,2-4H2,1H3 | | InChIKey | LOSWWGJGSSQDKH-UHFFFAOYSA-N | | SMILES | C(O)C(O)COCC |
| Hazard Codes | Xi | | Risk Statements | 36-36/37/38 | | Safety Statements | 26-26-37/39 | | WGK Germany | 2 | | RTECS | TY6400000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Skin Irrit. 2 | | Toxicity | mammal (species unspecified),LD50,oral,> 5gm/kg (5000mg/kg),Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 39(4), Pg. 86, 1974. |
| Provider | Language |
|
ALFA
| English |
| | 3-ETHOXY-1,2-PROPANEDIOL Usage And Synthesis |
| Chemical Properties | 3-ethoxy-1,2-propanediol (3-ethoxy-1,2-propanediol), a glycerol short-chain aliphatic ether solvent, a viscous, stable, absorbent liquid, colorless and odorless, miscible with water, ethanol and many organic solvents. | | Uses | 3-Ethoxy-1,2-propanediol is a possbile antiknock additive for gasoline and diesel fuel. |
| | 3-ETHOXY-1,2-PROPANEDIOL Preparation Products And Raw materials |
|