| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-Boc-4-(Fmoc-amino)azepane-4-carboxylic acid Basic information |
| Product Name: | 1-Boc-4-(Fmoc-amino)azepane-4-carboxylic acid | | Synonyms: | 1-(tert-Butoxycarbonyl)-4-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-azepanecarboxylic acid;1H-AZEPINE-1,4-DICARBOXYLIC ACID, 4-[[(9H-FLUOREN-9-YLMETHOXY)CARBONYL]AMINO]HEXAHYDRO-, 1-(1,1-DIME;1H-Azepine-1,4-dicarboxylic acid, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]hexahydro-, 1-(1,1-dimethylethyl) ester;1-Boc-4-(Fmoc-amino)azepane-4-carboxylic acid | | CAS: | 889942-05-6 | | MF: | C27H32N2O6 | | MW: | 480.55 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | Mol File |  |
| | 1-Boc-4-(Fmoc-amino)azepane-4-carboxylic acid Chemical Properties |
| Boiling point | 667.0±55.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | pka | 3.85±0.20(Predicted) | | form | solid | | InChIKey | XPVAXXLOYCXBSS-UHFFFAOYSA-N | | SMILES | O=C(OCC1C2=CC=CC=C2C3=CC=CC=C31)NC4(C(O)=O)CCN(C(OC(C)(C)C)=O)CCC4 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1 |
| | 1-Boc-4-(Fmoc-amino)azepane-4-carboxylic acid Usage And Synthesis |
| | 1-Boc-4-(Fmoc-amino)azepane-4-carboxylic acid Preparation Products And Raw materials |
|