|
|
| | 1-(1-Methyl-4-piperidinyl)piperazine Basic information |
| | 1-(1-Methyl-4-piperidinyl)piperazine Chemical Properties |
| Melting point | 29-32℃ | | Boiling point | 99°C/0.08mm | | density | 0.99g/ml | | refractive index | n20/D 1.508 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) | | form | Liquid | | pka | 9.28±0.10(Predicted) | | color | Clear colorless to slightly yellow | | Sensitive | Air Sensitive | | InChI | InChI=1S/C10H21N3/c1-12-6-2-10(3-7-12)13-8-4-11-5-9-13/h10-11H,2-9H2,1H3 | | InChIKey | OHUMKYGINIODOY-UHFFFAOYSA-N | | SMILES | N1(C2CCN(C)CC2)CCNCC1 | | CAS DataBase Reference | 23995-88-2(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2735 8/PG 2 | | WGK Germany | 3 | | F | 10-34 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29335990 |
| | 1-(1-Methyl-4-piperidinyl)piperazine Usage And Synthesis |
| Uses | 1-(1-Methylpiperidin-4-yl)piperazine is used in preparation of Pyrazolo Estratrienes as inhibitors of 17-HSD1. |
| | 1-(1-Methyl-4-piperidinyl)piperazine Preparation Products And Raw materials |
|