1-Methyl-L-histidine manufacturers
- 1-Methyl-L-histidine
-
- $3.00
-
2020-02-01
- CAS:332-80-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100KG
|
| | 1-Methyl-L-histidine Basic information |
| | 1-Methyl-L-histidine Chemical Properties |
| Melting point | ~240 °C (dec.) (lit.) | | alpha | -24 º (c=2% in H2O) | | Boiling point | 298.47°C (rough estimate) | | density | 1.2509 (rough estimate) | | refractive index | 1.5950 (estimate) | | storage temp. | 2-8°C(protect from light) | | solubility | Methanol (Slightly), Water (Slightly, Sonicated) | | pka | 1.69(at 25℃) | | form | Solid | | color | Off-White to Pale Beige | | Optical Rotation | [α]20/D 24±1°, c = 2% in H2O | | BRN | 9727 | | Stability: | Hygroscopic | | Major Application | peptide synthesis | | InChI | 1S/C7H11N3O2/c1-10-3-5(9-4-10)2-6(8)7(11)12/h3-4,6H,2,8H2,1H3,(H,11,12)/t6-/m0/s1 | | InChIKey | BRMWTNUJHUMWMS-LURJTMIESA-N | | SMILES | Cn1cnc(C[C@H](N)C(O)=O)c1 | | CAS DataBase Reference | 332-80-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25-22 | | WGK Germany | 3 | | HS Code | 29332900 | | Storage Class | 11 - Combustible Solids |
| | 1-Methyl-L-histidine Usage And Synthesis |
| Chemical Properties | Beige powder | | Uses | The urinary 1- and 3-methylhistidine (1- and 3-MH) metabolites as potential biomarkers of skeletal muscle toxicity. These metabolites were highly correlated to sex-, dose-, and time-dependent development of cerivastatin-induced myotoxicity. Natural but non-proteinogenic amino acid; employed as index of muscle protein breakdown. | | Definition | ChEBI: N(tele)-methyl-L-histidine is a L-histidine derivative in which the methyl group is at N(tele)-position. It has a role as a human metabolite. It is a L-histidine derivative and a non-proteinogenic L-alpha-amino acid. It is a tautomer of a N(tele)-methyl-L-histidine zwitterion. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 1-Methyl-L-histidine Preparation Products And Raw materials |
|