|
|
| | Tripropyl orthoformate Basic information |
| | Tripropyl orthoformate Chemical Properties |
| Boiling point | 106-108 °C/40 mmHg (lit.) | | density | 0.883 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.407(lit.) | | Fp | 162 °F | | form | Liquid | | color | Clear colorless | | Specific Gravity | 0.883 | | Sensitive | Moisture Sensitive | | BRN | 1744249 | | InChI | InChI=1S/C10H22O3/c1-4-7-11-10(12-8-5-2)13-9-6-3/h10H,4-9H2,1-3H3 | | InChIKey | RWNXXQFJBALKAX-UHFFFAOYSA-N | | SMILES | C(OCCC)(OCCC)OCCC | | CAS DataBase Reference | 621-76-1(CAS DataBase Reference) | | NIST Chemistry Reference | Tripropyl orthoformate(621-76-1) | | EPA Substance Registry System | Tripropyl orthoformate (621-76-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-37/39 | | RIDADR | 1993 | | WGK Germany | 1 | | F | 10-21 | | TSCA | TSCA listed | | HS Code | 29159000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Tripropyl orthoformate Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Tripropyl orthoformate was used as alcohol donor to investigate the activity and enantioselectivity of Novozym 435 in the esterification of rac-fenoprofen in methylcyclohexane. It may be used as a drying agent during the synthesis of squaraine derivatives. | | Uses | Tripropoxymethane can be used in the lipase-catalyzed esterification aimed at the kinetic resolution of racemic acids, circumventing the adverse effects of the water formed in the course of the reaction. | | Synthesis Reference(s) | Journal of the American Chemical Society, 77, p. 3801, 1955 DOI: 10.1021/ja01619a036 | | General Description | Gas phase reactions of the rare earth metal cations with tripropyl orthoformate were studied by Fourier transform ion cyclotron resonance mass spectrometry. |
| | Tripropyl orthoformate Preparation Products And Raw materials |
|