|
|
| | Potassium (R)-[(3-ethoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate Basic information |
| | Potassium (R)-[(3-ethoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate Chemical Properties |
| Melting point | 230-234 °C(lit.) | | alpha | -78 º (c=1,1N HCl) | | Boiling point | 233.6℃[at 101 325 Pa] | | density | 1.275[at 20℃] | | vapor pressure | 0Pa at 25℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1/C14H17NO4.K/c1-3-19-12(16)9-10(2)15-13(14(17)18)11-7-5-4-6-8-11;/h4-9,13,15H,3H2,1-2H3,(H,17,18);/q;+1/p-1/b10-9+;/t13-;/s3 | | InChIKey | QMWWAEFYIXXXQW-ULLCECHZNA-M | | SMILES | C1(C=CC=CC=1)[C@H](C([O-])=O)N/C(/C)=C/C(=O)OCC.[K+] |&1:6,r| | | CAS DataBase Reference | 961-69-3(CAS DataBase Reference) | | EPA Substance Registry System | Benzeneacetic acid, .alpha.-[(3-ethoxy-1-methyl-3-oxo-1-propenyl)amino]-, monopotassium salt, (.alpha.R)- (961-69-3) |
| WGK Germany | 3 | | TSCA | TSCA listed |
| | Potassium (R)-[(3-ethoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate Usage And Synthesis |
| Uses | N-Methylbut-2-enoate Ethyl Ester D-(-)Phenylglycine Potassium Salt is used in the synthesis of semisynthetic penicillins and cephalosporins. | | Flammability and Explosibility | Non flammable |
| | Potassium (R)-[(3-ethoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate Preparation Products And Raw materials |
|