| Company Name: |
Career Henan Chemica Co |
| Tel: |
+86-0371-86658258 +8613203830695 |
| Email: |
laboratory@coreychem.com |
| Products Intro: |
Product Name:6-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]-1,2,3,4-tetrahydroquinoline
CAS:5455-90-3
Purity:98% CRYLIU Package:1g;0.1USD
|
|
|
|
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58851090 15955137747 |
| Email: |
sales01@aikonchem.com |
| Products Intro: |
Product Name:6-[(4ar,8as)-octahydroquinolin-1(2H)-ylsulfonyl]-1,2,3,4-tetrahydroquinoline
CAS:5455-90-3
Purity:95+% Package:1g;5g;10g
|
| Company Name: |
Amel Pharmatech Corporation
|
| Tel: |
027-888-4366503 |
| Email: |
sales@amelpharmatech.com |
| Products Intro: |
Product Name:6-[(4AR,8AS)-OCTAHYDROQUINOLIN-1(2H)-YLSULFONYL]-1,2,3,4-TETRAHYDROQUINOLINE
CAS:5455-90-3
Purity:95% Package:g; kg
|
|
| | 6-[(4ar,8as)-octahydroquinolin-1(2H)-ylsulfonyl]-1,2,3,4-tetrahydroquinoline Basic information |
| Product Name: | 6-[(4ar,8as)-octahydroquinolin-1(2H)-ylsulfonyl]-1,2,3,4-tetrahydroquinoline | | Synonyms: | 6-[(4ar,8as)-octahydroquinolin-1(2H)-ylsulfonyl]-1,2,3,4-tetrahydroquinoline;7-(((4aS,8aR)-octahydroquinolin-1(2H)-yl)sulfonyl)-1,2,3,4-tetrahydroquinoline;6-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]-1,2,3,4-tetrahydroquinoline;Quinoline, decahydro-1-[(1,2,3,4-tetrahydro-6-quinolinyl)sulfonyl]-, trans- (9CI);miR-122 Inhibitor, NSC5476 | | CAS: | 5455-90-3 | | MF: | C18H26N2O2S | | MW: | 334.48 | | EINECS: | | | Product Categories: | | | Mol File: | 5455-90-3.mol | ![6-[(4ar,8as)-octahydroquinolin-1(2H)-ylsulfonyl]-1,2,3,4-tetrahydroquinoline Structure](CAS/20200401/GIF/5455-90-3.gif) |
| | 6-[(4ar,8as)-octahydroquinolin-1(2H)-ylsulfonyl]-1,2,3,4-tetrahydroquinoline Chemical Properties |
| Boiling point | 517.8±60.0 °C(Predicted) | | density | 1.196±0.06 g/cm3(Predicted) | | storage temp. | +2C to +8C | | solubility | DMSO: 50mg/mL | | form | White solid | | pka | 1.73±0.20(Predicted) | | color | white | | InChI | 1S/C18H26N2O2S/c21-23(22,16-9-10-17-15(13-16)6-3-11-19-17)20-12-4-7-14-5-1-2-8-18(14)20/h9-10,13-14,18-19H,1-8,11-12H2/t14-,18+/m1/s1 | | InChIKey | LECPJKATPJRAMB-KDOFPFPSSA-N | | SMILES | [S](=O)(=O)(N3[C@@H]4[C@@H](CCC3)CCCC4)c1cc2c(cc1)NCCC2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 6-[(4ar,8as)-octahydroquinolin-1(2H)-ylsulfonyl]-1,2,3,4-tetrahydroquinoline Usage And Synthesis |
| Uses | A cell-permeable trans-decahydroquinolinylsulfonamide compound that acts as a potent, selective, and reversible inhibitor of miR-122 (EC50 = 600 nM in Huh7 cells transfected with psiCHECK-miR122 reporter plasmid). Induces a 1,250% increase in the relative luciferase signal that is indicative of strong miRNA-122 inhibition. Displays very little activity towards miR-21. Shown to down regulate the levels of mature miR-122 (by 72%) and the primary miR-122 (down to 3%). Shown to reduce hepatitis C virus (HCV) replication in Huh7 cells (47% reduction at 10 µM).
Please note that the molecular weight for this compound is batch-specific due to variable water content. Please refer to the vial label or the certificate of analysis for the batch-specific molecular weight. The molecular weight provided represents the baseline molecular weight without water. | | Biological Activity | Cell permeable: yes', 'Primary Target
miR-122', 'Reversible: yes |
| | 6-[(4ar,8as)-octahydroquinolin-1(2H)-ylsulfonyl]-1,2,3,4-tetrahydroquinoline Preparation Products And Raw materials |
|