| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:5-Methoxy-1-indanone-3-acetic acid CAS:24467-92-3 Purity:0.97 Remarks:B35943
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:5-Methoxy-1-indanone-3-acetic acid CAS:24467-92-3 Purity:technical grade Package:1G Remarks:225282-1G
|
|
| | 5-METHOXY-1-INDANONE-3-ACETIC ACID Basic information |
| | 5-METHOXY-1-INDANONE-3-ACETIC ACID Chemical Properties |
| Melting point | 139-144 °C (lit.) | | Boiling point | 429℃ | | density | 1.286 | | Fp | 171℃ | | solubility | chloroform: soluble5%, clear, yellow-brown | | form | powder | | InChI | 1S/C12H12O4/c1-16-8-2-3-9-10(6-8)7(4-11(9)13)5-12(14)15/h2-3,6-7H,4-5H2,1H3,(H,14,15) | | InChIKey | QOTZOFGBBCMWEP-UHFFFAOYSA-N | | SMILES | COc1ccc2C(=O)CC(CC(O)=O)c2c1 |
| WGK Germany | 3 | | RTECS | NK8225760 | | Storage Class | 11 - Combustible Solids |
| | 5-METHOXY-1-INDANONE-3-ACETIC ACID Usage And Synthesis |
| Uses | The 5-methoxy-1-indanone-3-acetic acid derivatives are potent inhibitors of chymotrypsin-like activity of the 20S proteasome. | | General Description | The 5-methoxy-1-indanone-3-acetic acid derivatives are potent inhibitors of chymotrypsin-like activity of the 20S proteasome. |
| | 5-METHOXY-1-INDANONE-3-ACETIC ACID Preparation Products And Raw materials |
|