- (-)-(S)-B-973B
-
- $38.00
-
2026-08-23
- CAS:2244989-34-0
- Purity: 99.52%
- Supply Ability: 10g
|
| | (-)-(S)-B973B Basic information |
| Product Name: | (-)-(S)-B973B | | Synonyms: | (-)-(S)-B973B;CS-2844;B 973;B-973;B973;2244989-34-0;(S)-3-(3,4-difluorophenyl)-N-(1-(6-(4-(pyridin-2-yl)piperazin-1-yl)pyrazin-2-yl)ethyl)propanamide;(-)-(S)-B-973B;Benzenepropanamide, 3,4-difluoro-N-[(1S)-1-[6-[4-(2-pyridinyl)-1-piperazinyl]-2-pyrazinyl]ethyl]-;(-)-B-973;3,4-Difluoro-N-[(1S)-1-[6-[4-(2-pyridinyl)-1-piperazinyl]-2-pyrazinyl]ethyl]benzenepropanamide | | CAS: | 2244989-34-0 | | MF: | C24H26F2N6O | | MW: | 452.5 | | EINECS: | | | Product Categories: | | | Mol File: | 2244989-34-0.mol |  |
| | (-)-(S)-B973B Chemical Properties |
| Boiling point | 699.6±55.0 °C(Predicted) | | density | 1.275±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO : 67.5 mg/mL (149.17 mM) | | form | Solid | | pka | 14.07±0.46(Predicted) | | color | Light yellow to yellow | | InChIKey | WQYZERNSONBUCW-KRWDZBQOSA-N | | SMILES | C1(CCC(N[C@H](C2=NC(N3CCN(C4=NC=CC=C4)CC3)=CN=C2)C)=O)=CC=C(F)C(F)=C1 |
| | (-)-(S)-B973B Usage And Synthesis |
| Uses | The alpha7 (α7) nicotinic acetylcholine receptor is a therapeutic target for cognitive disorders. D684230 is a novel piperazine-containing molecule that acts as a possible allosteric modulator of the α7 receptor. | | storage | Store at -20°C |
| | (-)-(S)-B973B Preparation Products And Raw materials |
|