| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Hydroquinone bisfluorosulfate Basic information |
| Product Name: | Hydroquinone bisfluorosulfate | | Synonyms: | Fluorosulfuric acid, 1,4-phenylene ester (9CI);1,4-phenylene bis(sulfurofluoridate);1,4-Phenylene bis(fluorosulfonate;Hydroquinone bisfluorosulfate | | CAS: | 42158-97-4 | | MF: | C6H4F2O6S2 | | MW: | 274.22 | | EINECS: | | | Product Categories: | | | Mol File: | 42158-97-4.mol |  |
| | Hydroquinone bisfluorosulfate Chemical Properties |
| form | solid | | InChI | 1S/C6H4F2O6S2/c7-15(9,10)13-5-1-2-6(4-3-5)14-16(8,11)12/h1-4H | | InChIKey | OEJXDBMJMKHHMQ-UHFFFAOYSA-N | | SMILES | FS(OC1=CC=C(OS(F)(=O)=O)C=C1)(=O)=O |
| RIDADR | UN 3261 8 / PGII | | WGK Germany | WGK 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | Hydroquinone bisfluorosulfate Usage And Synthesis |
| Uses | The following aryl fluorosulfate can be utilized as a cross-coupling partner in Suzuki-Miyaura reactions. The standard reaction conditions for these palladium-catalyzed C-C bond formations are ligand-free and can be performed in water, at room temperature and are not air sensitive. |
| | Hydroquinone bisfluorosulfate Preparation Products And Raw materials |
|