|
|
| | 1,4-Diacryloylpiperazine Basic information |
| | 1,4-Diacryloylpiperazine Chemical Properties |
| Melting point | 91.5-93.5 °C(lit.) | | Boiling point | 434.1±25.0 °C(Predicted) | | density | 1.114±0.06 g/cm3(Predicted) | | RTECS | UD6715000 | | storage temp. | room temp | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | powder | | pka | -0.70±0.70(Predicted) | | color | White to off-white | | BRN | 745431 | | InChI | InChI=1S/C10H14N2O2/c1-3-9(13)11-5-7-12(8-6-11)10(14)4-2/h3-4H,1-2,5-8H2 | | InChIKey | YERHJBPPDGHCRJ-UHFFFAOYSA-N | | SMILES | N1(C(=O)C=C)CCN(C(=O)C=C)CC1 | | CAS DataBase Reference | 6342-17-2(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8 | | HS Code | 29335995 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,4-Diacryloylpiperazine Usage And Synthesis |
| Chemical Properties | Off-white solid | | Uses | Used as a crosslinker in polyacrylamide gels. PIP provides polyacrylamide gels with increased physical strength and improved separation and detection of proteins. | | Uses | Suitable for preparation of gels for PAGE, IEF, 2D electrophoresis and protein sequencing. | | Uses | 1,4-Diacryloylpiperazine is used as a crosslinker in polyacrylamide gels. PIP provides polyacrylamide gels with increased physical strength and improved separation and detection of proteins | | Definition | ChEBI: 1-[4-(1-oxoprop-2-enyl)-1-piperazinyl]-2-propen-1-one is a N-acylpiperazine and a tertiary carboxamide. | | General Description | 1,4-Bis(acryloyl)piperazine is a reagent that can be substituted for bis-acrylamide in the preparation of polyacrylamide gels. |
| | 1,4-Diacryloylpiperazine Preparation Products And Raw materials |
|