|
|
| | 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylic acid hydrochloride Basic information |
| | 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylic acid hydrochloride Chemical Properties |
| form | solid | | InChI | 1S/C6H8N2O2S.ClH/c1-3-5(6(9)10)11-4(2-7)8-3;/h2,7H2,1H3,(H,9,10);1H | | InChIKey | NXRGWUMGLZKFKP-UHFFFAOYSA-N | | SMILES | CC1=C(C(O)=O)SC(CN)=N1.Cl |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylic acid hydrochloride Usage And Synthesis |
| | 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylic acid hydrochloride Preparation Products And Raw materials |
|