- Fmoc-L-Arg(NO2)-OH
-
-
2026-07-09
- CAS:58111-94-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- Fmoc-Arg(NO2)-OH
-
-
2026-01-04
- CAS:58111-94-7
- Min. Order: 1Box
- Purity: 99%
- Supply Ability: 200kg
- FMoc-Arg(NO2)-OH
-
- $1.10
-
2025-06-25
- CAS:58111-94-7
- Min. Order: 1g
- Purity: 99.0% min
- Supply Ability: 100 tons min
|
| | FMOC-ARG(NO2)-OH Basic information |
| | FMOC-ARG(NO2)-OH Chemical Properties |
| density | 1.47±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Powder | | pka | 3.81±0.21(Predicted) | | color | White | | BRN | 7060334 | | Major Application | peptide synthesis | | InChIKey | RXMHIKWOZKQXCJ-SFHVURJKSA-N | | SMILES | OC(=O)[C@H](CCCNC(=N)N[N+]([O-])=O)NC(=O)OCC1c2ccccc2-c3ccccc13 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 13 - Non Combustible Solids |
| | FMOC-ARG(NO2)-OH Usage And Synthesis |
| Uses | peptide synthesis | | General Description | may contain ~8% (w/w) solvent | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-ARG(NO2)-OH Preparation Products And Raw materials |
|