- 2-Amino-4-fluorobenzoic acid
-
- $200.00 / 1KG
-
2025-09-25
- CAS:446-32-2
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-Amino-4-fluorobenzoic acid Basic information |
| | 2-Amino-4-fluorobenzoic acid Chemical Properties |
| Melting point | 192-196 °C (lit.) | | Boiling point | 223.67°C (rough estimate) | | density | 1.3021 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 4.88±0.10(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | BRN | 2803665 | | Major Application | peptide synthesis | | InChI | InChI=1S/C7H6FNO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,9H2,(H,10,11) | | InChIKey | LGPVTNAJFDUWLF-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(F)C=C1N | | CAS DataBase Reference | 446-32-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Amino-4-fluorobenzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 4-Fluoroanthranilic Acid (cas# 446-32-2) is a compound useful in organic synthesis. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 2-Amino-4-fluorobenzoic acid Preparation Products And Raw materials |
|