3,4-difluoro-2-((phenylthio)methyl)benzoic acid manufacturers
|
| | 3,4-difluoro-2-((phenylthio)methyl)benzoic acid Basic information |
| Product Name: | 3,4-difluoro-2-((phenylthio)methyl)benzoic acid | | Synonyms: | 3,4-difluoro-2-((phenylthio)methyl)benzoic acid;Baloxavir Impurity 47;Benzoic acid, 3,4-difluoro-2-[(phenylthio)methyl]-;3,4-Difluoro-2-((phenylthio)methyl)benzoic AcidQ: What is
3,4-Difluoro-2-((phenylthio)methyl)benzoic Acid Q: What is the CAS Number of
3,4-Difluoro-2-((phenylthio)methyl)benzoic Acid;Baloxavixate Impurity 20;Baloxavir Impurity 17 | | CAS: | 2136287-65-3 | | MF: | C14H10F2O2S | | MW: | 280.29 | | EINECS: | | | Product Categories: | | | Mol File: | 2136287-65-3.mol |  |
| | 3,4-difluoro-2-((phenylthio)methyl)benzoic acid Chemical Properties |
| Boiling point | 413.2±45.0 °C(Predicted) | | density | 1.39±0.1 g/cm3(Predicted) | | pka | 3.50±0.36(Predicted) | | InChI | InChI=1S/C14H10F2O2S/c15-12-7-6-10(14(17)18)11(13(12)16)8-19-9-4-2-1-3-5-9/h1-7H,8H2,(H,17,18) | | InChIKey | YLPPWUHTBLHWOM-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(F)C(F)=C1CSC1=CC=CC=C1 |
| | 3,4-difluoro-2-((phenylthio)methyl)benzoic acid Usage And Synthesis |
| | 3,4-difluoro-2-((phenylthio)methyl)benzoic acid Preparation Products And Raw materials |
|