Cholesteryl formate manufacturers
- Cholesteryl formate
-
- $68.00 / 50mg
-
2026-01-15
- CAS:4351-55-7
- Min. Order:
- Purity: 99.38%
- Supply Ability: 10g
|
| | Cholesteryl formate Basic information |
| | Cholesteryl formate Chemical Properties |
| Melting point | 95 °C | | Boiling point | 487.1±15.0 °C(Predicted) | | density | 1.00±0.1 g/cm3(Predicted) | | InChIKey | YEYCQJVCAMFWCO-GUUSYENVNA-N | | SMILES | [C@@]12([H])CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@H](OC=O)CC3=CC[C@@]21[H] |&1:0,4,5,13,17,19,23,31,r| | | LogP | 10.298 (est) | | CAS DataBase Reference | 4351-55-7(CAS DataBase Reference) | | NIST Chemistry Reference | Cholesteryl formate(4351-55-7) |
| Safety Statements | 24/25 | | HS Code | 29151300 |
| | Cholesteryl formate Usage And Synthesis |
| Definition | ChEBI: Cholesterol ester 14:1 is a cholesteryl ester. |
| | Cholesteryl formate Preparation Products And Raw materials |
|