(1S)-(+)-CAMPHORQUINONE manufacturers
|
| | (1S)-(+)-CAMPHORQUINONE Basic information |
| | (1S)-(+)-CAMPHORQUINONE Chemical Properties |
| Melting point | 197-201 °C(lit.) | | alpha | +100° (20/D)(c=1.9, C6H5CH3) | | Boiling point | 234.44°C (rough estimate) | | density | 0.9817 (rough estimate) | | refractive index | 1.4859 (estimate) | | form | powder to crystal | | color | White to Yellow to Orange | | Optical Rotation | [α]20/D +100°, c = 1.9 in toluene | | BRN | 2613999 | | InChI | 1S/C10H14O2/c1-9(2)6-4-5-10(9,3)8(12)7(6)11/h6H,4-5H2,1-3H3/t6-,10+/m0/s1 | | InChIKey | VNQXSTWCDUXYEZ-QUBYGPBYSA-N | | SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=O)C2=O | | CAS DataBase Reference | 2767-84-2(CAS DataBase Reference) | | EPA Substance Registry System | Bicyclo[2.2.1]heptane-2,3-dione, 1,7,7-trimethyl-, (1S,4R)- (2767-84-2) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | TSCA | TSCA listed | | HS Code | 29142900 | | Storage Class | 11 - Combustible Solids |
| | (1S)-(+)-CAMPHORQUINONE Usage And Synthesis |
| Chemical Properties | YELLOW POWDER | | Uses | Chiral starting material. | | Definition | ChEBI: (1S)-bornane-2,3-dione is a bornane-2,3-dione. It is an enantiomer of a (1R)-bornane-2,3-dione. | | Purification Methods | It can be purified by steam distillation, recrystallisation (yellow prisms) from EtOH, *C6H6 or Et2O/pet ether and it can be sublimed in a vacuum. The (±)-quinone forms needles from EtOH, m 197-198o, 203o. [Buxtorf & Flatt Helv Chim Acta 13 1026 1930, Asahena et al. Chem Ber 67 1432 1934, Beiltein 7 I 325.] |
| | (1S)-(+)-CAMPHORQUINONE Preparation Products And Raw materials |
|