|
|
| | 5-Amino-3-fluorobenzonitrile Basic information |
| | 5-Amino-3-fluorobenzonitrile Chemical Properties |
| Melting point | 105-107°C | | Boiling point | 288.6±20.0 °C(Predicted) | | density | 1.25 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder | | pka | 1.77±0.10(Predicted) | | color | Pale lemon | | InChI | InChI=1S/C7H5FN2/c8-6-1-5(4-9)2-7(10)3-6/h1-3H,10H2 | | InChIKey | FJHVWOFTAJCONF-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(F)=CC(N)=C1 | | CAS DataBase Reference | 210992-28-2(CAS DataBase Reference) |
| Hazard Codes | T,Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 3439 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 2926907090 |
| | 5-Amino-3-fluorobenzonitrile Usage And Synthesis |
| | 5-Amino-3-fluorobenzonitrile Preparation Products And Raw materials |
|