|
|
| | 1-BUTYL-3-METHYLIMIDAZOLIUM BIS(TRIFLUOR Basic information |
| Product Name: | 1-BUTYL-3-METHYLIMIDAZOLIUM BIS(TRIFLUOR | | Synonyms: | BMIIm, BMIM TFSI;1-Butyl-3-methylimidazolium Bis(trifluoromethanesulfonyl);Basionics(R) HP 02;Basionics? HP 02;1-Butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide >=98%;1-Butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide >=98.0% (HPLC);3-butyl-1-methyl-1H-Imidazolium 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide;1-Butyl-3-MethyliMidazoliuM bis(trifluoroMethylsulfonyl)iMide BASF quality, >=98% | | CAS: | 174899-83-3 | | MF: | C8H15N2.C2F6NO4S2 | | MW: | 419.366 | | EINECS: | 205-516-1 | | Product Categories: | Chemical Synthesis;Imidazolium;Ionic Liquids;Specialty Synthesis | | Mol File: | 174899-83-3.mol |  |
| | 1-BUTYL-3-METHYLIMIDAZOLIUM BIS(TRIFLUOR Chemical Properties |
| Melting point | 1℃ | | density | 1.44 g/cm3 | | refractive index | n20/D 1.428 | | Fp | >200 ºC | | storage temp. | Store below +30°C. | | Water Solubility | Insoluble in water | | form | liquid | | color | Colorless to Light orange to Yellow | | PH | 7 (H2O, 20℃)Aqueous solution | | InChI | InChI=1S/C8H15N2.C2F6NO4S2/c1-3-4-5-10-7-6-9(2)8-10;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h6-8H,3-5H2,1-2H3;/q+1;-1 | | InChIKey | INDFXCHYORWHLQ-UHFFFAOYSA-N | | SMILES | S(=O)(=O)(C(F)(F)F)[N-]S(=O)(=O)C(F)(F)F.[N+]1(C)C=CN(CCCC)C=1 | | ECW | 4,62 V |
| Hazard Codes | T,N | | Risk Statements | 36/37/38-51/53-48/22-34-24/25 | | Safety Statements | 26-36-61-45-36/37/39 | | RIDADR | UN 2922 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 8, 6.1 | | HS Code | 29350090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Oral
Aquatic Chronic 2
Eye Dam. 1
Skin Corr. 1B
STOT RE 2 Oral |
| | 1-BUTYL-3-METHYLIMIDAZOLIUM BIS(TRIFLUOR Usage And Synthesis |
| Conductivity | 3.41 mS/cm | | Uses | Ionic liquids (ILs) are molten salts with melting points lower than 100 °C. They usually consist of pair of organic cation and anion. ILs exhibit unique properties such as non-volatility, high thermal stability, and high ionic conductivity and find applications as electrolytes in lithium/sodium ion batteries and dye-sensitized solar cells. They are also used as media for synthesis of conducting polymers and intercalation electrode materials. | | Uses | 1-Butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide is a hydrophobic ionic liquid that can enhance the activity of N,N,N′,N′-tetra(n-octyl)diglycolamide (TODGA) extractant in the extraction of uranium(VI) from an aqueous nitric acid media. | | Uses | Solarpur electrolyte components for DSSC applications meet the highest purity standards regarding water and other impurities required for this technology. | | General Description | 1-Butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide is a room temperature ionic liquid (RTIL). The solubility of alkane gases are less than the alkene gas in this IL. Its ability to solubilize CO2 is more when compared to 1-butyl-3-methylimidazolium dicyanamide. | | Synthesis | The general procedure for the synthesis of 1-butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide from N-butylimidazole and dimethyl sulfate is as follows:
1. 620.5 g (5 mol) of N-butylimidazole was added to a 5 liter reaction vessel, followed by the addition of 630.5 g (5 mol) of dimethyl sulfate in batches.
2. the mixture was stirred for 15 minutes to ensure adequate reaction.
3. 1435.3 g (5 mol) of lithium bis(trifluoromethanesulfonyl)imide dissolved in 2 liters of water was added to the reaction mixture, and the formation of a second liquid phase of the product was immediately observed.
4. Phase separation was carried out and the organic phase was collected and dried under high vacuum (HV) at 60 °C to afford 1-butyl-3-methylimidazolium bis(trifluoromethanesulfonyl)imide in 98% yield.
5. To detect residual chlorides, about 1 g of the product was dissolved in 5 ml of water, acidified with 2 drops of concentrated nitric acid and then 3-4 drops of silver nitrate solution were added. No precipitation of silver chloride was observed indicating that no halide ions remained in the product. 6.
6. The 1H-NMR (300 MHz, acetone-d3) data of the product were as follows: 0.95 (3H, t, J=9.2 Hz, Hh); 1.33-1.39 (2H, m, Hg); 1.90-2.00 (2H, m, Hf); 4.07 (3H, s, Hb); 4.37 (2H, t, J=9.3 Hz, He); 7.71 (1H, t, J=9.3 Hz, Hb); 7.76 (1H, s, Hb); 4.37 (2H, t, J=9.3 Hz, He); and 7.71 (1H, s, Hb). ,7.76 (1H, s, Hc, d); 9.02 (1H, s, Ha) ppm. | | References | [1] Patent: EP1182196, 2002, A1. Location in patent: Page 14, 15 |
| | 1-BUTYL-3-METHYLIMIDAZOLIUM BIS(TRIFLUOR Preparation Products And Raw materials |
|