| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:trans-2,3,4,5,6-Pentafluoro-β-nitrostyrene
CAS:207605-39-8
Purity:96% Package:1G,5G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:trans-2,3,4,5,6-Pentafluoro-beta-nitrostyrene
CAS:207605-39-8
Purity:96% Package:5G Remarks:273341-5G
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:trans-2,3,4,5,6-Pentafluoro-β-nitrostyrene
CAS:207605-39-8
|
|
| | TRANS-2 3 4 5 6-PENTAFLUORO-BETA-NITRO-& Basic information |
| Product Name: | TRANS-2 3 4 5 6-PENTAFLUORO-BETA-NITRO-& | | Synonyms: | TRANS-2 3 4 5 6-PENTAFLUORO-BETA-NITRO-&;2,3,4,5,6-PENTAFLUORO-BETA-NITROSTYRENE;trans-2,3,4,5,6-pentafluoro-β-nitrostyrene;trans-2,3,4,5,6-Pentafluoro-β-nitrostyrene,96%;Benzene, 1,2,3,4,5-pentafluoro-6-[(1E)-2-nitroethenyl]-;trans-2,3,4,5,6-Pentafluoro-β-nitrostyrene;(E)-1,2,3,4,5-Pentafluoro-6-(2-nitrovinyl)benzene | | CAS: | 207605-39-8 | | MF: | C8H2F5NO2 | | MW: | 239.1 | | EINECS: | | | Product Categories: | Alkenyl;Halogenated Hydrocarbons;Organic Building Blocks | | Mol File: | 207605-39-8.mol |  |
| | TRANS-2 3 4 5 6-PENTAFLUORO-BETA-NITRO-& Chemical Properties |
| Melting point | 19 °C (lit.) | | Boiling point | 204 °C (lit.) | | density | 1.591 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.525(lit.) | | Fp | >230 °F | | InChI | 1S/C8H2F5NO2/c9-4-3(1-2-14(15)16)5(10)7(12)8(13)6(4)11/h1-2H/b2-1+ | | InChIKey | LBBACRWAXVCTNR-OWOJBTEDSA-N | | SMILES | [H]\C(=C(\[H])[N+]([O-])=O)c1c(F)c(F)c(F)c(F)c1F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | TRANS-2 3 4 5 6-PENTAFLUORO-BETA-NITRO-& Usage And Synthesis |
| Uses | trans-2,3,4,5,6-Pentafluoro-β-nitrostyrene may be used in chemical synthesis studies. |
| | TRANS-2 3 4 5 6-PENTAFLUORO-BETA-NITRO-& Preparation Products And Raw materials |
|