YTTRIUM(III) ACETATE HYDRATE manufacturers
|
| | YTTRIUM(III) ACETATE HYDRATE Basic information |
| | YTTRIUM(III) ACETATE HYDRATE Chemical Properties |
| form | powder | | InChI | 1S/3C2H4O2.H2O.Y/c3*1-2(3)4;;/h3*1H3,(H,3,4);1H2;/q;;;;+3/p-3 | | InChIKey | JRKVGRAQLBXGQB-UHFFFAOYSA-K | | SMILES | O.CC(=O)O[Y](OC(C)=O)OC(C)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2915290000 | | Storage Class | 11 - Combustible Solids |
| | YTTRIUM(III) ACETATE HYDRATE Usage And Synthesis |
| Uses |
- Optical study of Yttrium oxide doped with zinc prepared by simple methods: The research investigates the optical properties of yttrium oxide doped with zinc, using yttrium acetate hydrate in the synthesis process. (Bhavani, Ganesan, 2015).
- Thermal decomposition of yttrium propionate: film and powder: This paper details the thermal decomposition behavior of yttrium propionate, a compound related to yttrium acetate, providing insights into decomposition mechanisms and thermal stability. (Rasi et al., 2018).
- In Situ Ternary Adduct Formation of Yttrium Polyaminocarboxylates Leads to Small Molecule Capture and Activation: This research investigates the formation of ternary adducts with yttrium complexes, using acetate and other ligands, demonstrating potential applications in small molecule activation. (Tickner et al., 2022).
| | reaction suitability | core: yttrium reagent type: catalyst |
| | YTTRIUM(III) ACETATE HYDRATE Preparation Products And Raw materials |
|