| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Boc-L-Leu-OH-1-13C monohydrate 99 atom& Basic information |
| Product Name: | Boc-L-Leu-OH-1-13C monohydrate 99 atom& | | Synonyms: | N-(TERT-BUTOXYCARBONYL)-L-LEUCINE-1-13C MONOHYDRATE, 99 ATOM % 13C;N-(TERT-BUTOXYCARBONYL)-L-LEUCINE-1-13C 1-HYDRATE;boc-leu-oh-1-13c monohydrate;N-(tert-Butoxycarbonyl)-L-leucine-1-13C monohydrate, L-Leucine-1-13C, N-t-Boc derivative monohydrate;L-Leucine-1-13C, N-t-Boc derivative monohydrate;L-Leucine-??-??-Boc·H?O (1-13C, 99%);Boc-L-Leu-OH-1-13C monohydrate 99 atom& | | CAS: | 201740-80-9 | | MF: | C11H23NO5 | | MW: | 250.31302 | | EINECS: | | | Product Categories: | | | Mol File: | 201740-80-9.mol |  |
| | Boc-L-Leu-OH-1-13C monohydrate 99 atom& Chemical Properties |
| Melting point | 85-87 °C(lit.) | | storage temp. | 2-8°C | | form | solid | | Optical Rotation | [α]20/D 25°, c = 2 in acetic acid | | Major Application | peptide synthesis | | InChI | 1S/C11H21NO4.H2O/c1-7(2)6-8(9(13)14)12-10(15)16-11(3,4)5;/h7-8H,6H2,1-5H3,(H,12,15)(H,13,14);1H2/t8-;/m0./s1/i9+1; | | InChIKey | URQQEIOTRWJXBA-GQSAWZRISA-N | | SMILES | [H]O[H].CC(C)C[C@H](NC(=O)OC(C)(C)C)[13C](O)=O | | CAS Number Unlabeled | 13139-15-6 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Boc-L-Leu-OH-1-13C monohydrate 99 atom& Usage And Synthesis |
| | Boc-L-Leu-OH-1-13C monohydrate 99 atom& Preparation Products And Raw materials |
|