| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | Rac 8-hydroxy efavirenz Basic information |
| Product Name: | Rac 8-hydroxy efavirenz | | Synonyms: | 8-HydroxyEfavirenz;6-Chloro-4-(cyclopropyl-d4-ethynyl)-1,4-dihydro-8-hydroxy-4-(trifluoromethyl)-2H-3,1-benzoxazin-2-one;(4S)-6-chloro-4-(2-cyclopropylethynyl)-8-hydroxy-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one;Efavirenz Impurity 11(8-Hydroxy Efavirenz);2H-3,1-Benzoxazin-2-one, 6-chloro-4-(2-cyclopropylethynyl)-1,4-dihydro-8-hydroxy-4-(trifluoromethyl)-, (4S)-;8-Hydroxy EfavirenzQ: What is
8-Hydroxy Efavirenz Q: What is the CAS Number of
8-Hydroxy Efavirenz Q: What is the storage condition of
8-Hydroxy Efavirenz Q: What are the applications of
8-Hydroxy Efavirenz;2H-3,1-Benzoxazin-2-one,6-chloro-4-(cyclopropylethynyl)-1,4-dihydro-8-hydroxy-4-(trifluoromethyl)-, (4S)-;(S)-6-Chloro-4-(cyclopropylethynyl)-8-hydroxy-4-(trifluoromethyl)-1,4-dihydro-2H-benzo[d][1,3]oxazin-2-one | | CAS: | 205754-33-2 | | MF: | C14H9ClF3NO3 | | MW: | 331.67 | | EINECS: | | | Product Categories: | Intermediates & Fine Chemicals;Isotope Labeled Compounds;Metabolites;Non-nucleoside Reverse Transcriptase;Pharmaceuticals | | Mol File: | 205754-33-2.mol |  |
| | Rac 8-hydroxy efavirenz Chemical Properties |
| Melting point | 144-154°C | | Boiling point | 373.6±42.0 °C(Predicted) | | density | 1+-.0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Acetonitrile: soluble; DMSO: soluble; Methanol: soluble | | form | A solid | | pka | 7.18±0.40(Predicted) | | color | White to off-white | | InChI | InChI=1S/C14H9ClF3NO3/c15-8-5-9-11(10(20)6-8)19-12(21)22-13(9,14(16,17)18)4-3-7-1-2-7/h5-7,20H,1-2H2,(H,19,21)/t13-/m0/s1 | | InChIKey | OOVOMPCQLMFEDT-ZDUSSCGKSA-N | | SMILES | N1C2=C(O)C=C(Cl)C=C2[C@@](C#CC2CC2)(C(F)(F)F)OC1=O |
| | Rac 8-hydroxy efavirenz Usage And Synthesis |
| Description | 8-hydroxy Efavirenz is a major oxidative metabolite of the non-nucleoside reverse transcriptase inhibitor efavirenz . 8-hydroxy Efavirenz is formed when efavirenz is metabolized by the cytochrome P450 (CYP) isoform CYP2B6. It induces apoptosis in rat primary hippocampal neurons and loss of dendritic spines in rat primary hippocampal neuronal cultures when used at a concentration of 0.01 μM. | | Chemical Properties | Off-White Solid | | Uses | A labellebed metabolite of Efavirenz, a nonnucleoside HIV-1 reverse transcriptase inhibitor | | Uses | 8-Hydroxy Efavirenz is a metabolite of Efavirenz (E425000), a nonnucleoside HIV-1 reverse transcriptase inhibitor. | | References | [1] ERIC H DECLOEDT G M. Neuronal toxicity of efavirenz: a systematic review.[J]. Expert Opinion on Drug Safety, 2013, 12 6: 841-846. DOI: 10.1517/14740338.2013.823396
[2] LUIS B TOVAR-Y ROMO. Dendritic spine injury induced by the 8-hydroxy metabolite of efavirenz.[J]. Journal of Pharmacology and Experimental Therapeutics, 2012, 343 3: 696-703. DOI: 10.1124/jpet.112.195701 |
| | Rac 8-hydroxy efavirenz Preparation Products And Raw materials |
|