|
|
| | DMT-2′O-TBDMS-rU Phosphoramidite Basic information |
| Product Name: | DMT-2′O-TBDMS-rU Phosphoramidite | | Synonyms: | 5'-DMT-2'-O-TBDMS-Uridine Phosphoramidite;5'-DMT-2'-TBDMS-rU Phosphoramidite;5'-O-DMT-2'-O-tert-Butyldimethylsilyl-Uridine 3'-CE phosphoramidite;DMT-2'O-TBDMS-RU AMIDITE 10G, SINGLE;DMT-2'O-TBDMS-rU Amidite 2,5g, 12Pack;3-({[(2-{[BIS(4-METHOXYPHENYL)(PHENYL)METHOXY]METHYL}-4-[(TERT-BUTYLDIMETHYLSILYL)OXY]-5-(2,4-DIOXO-;DMT-2'O-TBDMS-rU Amidite 4g, 12Pack;2’-TBDMS-rU Phosphoramidite | | CAS: | 118362-03-1 | | MF: | C45H61N4O9PSi | | MW: | 861.05 | | EINECS: | 200-100-5 | | Product Categories: | Pharmaceutical;Amidite | | Mol File: | 118362-03-1.mol |  |
| | DMT-2′O-TBDMS-rU Phosphoramidite Chemical Properties |
| storage temp. | Sealed in dry,2-8°C | | form | powder | | pka | 9.39±0.10(Predicted) | | color | white to off-white | | biological source | non-animal source (no BSE/TSE risk) | | InChIKey | SKNLXHRBXYGJOC-ZMHKPELYSA-N | | SMILES | O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C=CC(=O)NC2=O)[C@H](O[Si](C(C)(C)C)(C)C)[C@@H]1OP(N(C(C)C)C(C)C)OCCC#N |&1:25,27,36,45,r| |
| WGK Germany | 3 | | HS Code | 29349990 |
| | DMT-2′O-TBDMS-rU Phosphoramidite Usage And Synthesis |
| Uses | DMT-2′O-TBDMS-rU Phosphoramidite was used in study of efficient enzyme-free copying of all four nucleobases templated by immobilized RNA. | | storage | Store at -20°C. For maximum recovery of product, centrifuge the original vial prior to removing the cap. |
| | DMT-2′O-TBDMS-rU Phosphoramidite Preparation Products And Raw materials |
|