| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | (R)-4,4-Dibutyl-2,6-bis(3,4,5-trifluorophenyl)-4,5-dihydro-3H-dinaphtho[7,6,1,2-cde]azepinium bromide Basic information | | Reaction |
| Product Name: | (R)-4,4-Dibutyl-2,6-bis(3,4,5-trifluorophenyl)-4,5-dihydro-3H-dinaphtho[7,6,1,2-cde]azepinium bromide | | Synonyms: | (11BR)-(-)-4,4-DIBUTYL-4,5-DIHYDRO-2,6-&;(R)-4,4-Dibutyl-2,6-bis(3,4,5-trifluorophenyl)-4,5-dihydro-3H-dinaphthol[7,6,1,2-cde]azepiniumbromide;(11bR)-(-)-4,4-Dibutyl-4,5-dihydro-2,6-bis(3,4,5-trifluorophenyl)-3H-dinaphth[2,1-c:1μ,2μ-e]azepinium bromide;(11bR)-(-)-4,4-Dibutyl-4,5-dihydro-2,6-bis(3,4,5-trifluorophenyl)-3H-dinaphth[2,1-c:1',2'-e]azepinium bromide Nagase purity;(R)-4,4-DIBUTYL-2,6-BIS(3,4,5-TRIFLUOROPHENYL)-4,5-DIHYDRO-3H-DINAPHTHO'7,6,1,2-CDEAZEPINIUM BROMIDE;(11bR)-4,4-Dibutyl-2,6-bis(3,4,5-trifluorophenyl)-4,5-dihydro-3H-dinaphtho[2,1-c:1',2'-e]azepinium bromide;(11bR)-(-)-4,4-Dibutyl-4,5-dihydro-2,6-bis(3,4,5-trifluorophenyl)-3H-dinaphth[2,1-c:1,2-e]azepiniu;4,4-Dibutyl-2,6-bis(3,4,5-trifluorophenyl)-4,5-dihydro-3H-dinaphtho[2,1-c:1',2'-e]azepin-4-ium bromide | | CAS: | 887938-70-7 | | MF: | C42H36BrF6N | | MW: | 748.6363592 | | EINECS: | | | Product Categories: | Asymmetric Synthesis;Chiral Catalysts, Ligands, and Reagents;Phase Transfer Reaction | | Mol File: | 887938-70-7.mol | ![(R)-4,4-Dibutyl-2,6-bis(3,4,5-trifluorophenyl)-4,5-dihydro-3H-dinaphtho[7,6,1,2-cde]azepinium bromide Structure](CAS/20180808/GIF/887938-70-7.gif) |
| | (R)-4,4-Dibutyl-2,6-bis(3,4,5-trifluorophenyl)-4,5-dihydro-3H-dinaphtho[7,6,1,2-cde]azepinium bromide Chemical Properties |
| Melting point | 223-228 °C | | form | Powder | | color | brown | | InChIKey | LOMUZNOWQYZTRP-UHFFFAOYSA-M | | SMILES | CCCC[N+]1(CCCC)Cc2c(cc3ccccc3c2-c4c(C1)c(cc5ccccc45)-c6cc(F)c(F)c(F)c6)-c7cc(F)c(F)c(F)c7 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-4,4-Dibutyl-2,6-bis(3,4,5-trifluorophenyl)-4,5-dihydro-3H-dinaphtho[7,6,1,2-cde]azepinium bromide Usage And Synthesis |
| Reaction |
- 2nd Generation Maruoka chiral phase transfer catalyst, for enantioselective alkylation of α-amino acid derivatives, that is easily recovered for recycle by extraction with fluorous solvent.
- Catalyst for asymmetric conjugate addition of α-substituted-α-cyanoacetates to α,β-unsaturated acetylenic esters.
- Phase transfer catalyzed enantioselective α-alkylation.
- Asymmetric amination of β-keto esters.
- Diastereo- and enantioselective conjugate addition of α-substituted nitroacetates to maleimides.
- Cyclization of β-alkynyl hydrazines.
| | Uses | Potent phase transfer organocatalyst for asymmetric α-alkylation of glycine derivatives at extremely low loadings. |
| | (R)-4,4-Dibutyl-2,6-bis(3,4,5-trifluorophenyl)-4,5-dihydro-3H-dinaphtho[7,6,1,2-cde]azepinium bromide Preparation Products And Raw materials |
|